ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine

Catalog Number ACM136469777
CAS 136469-77-7
Synonyms [2-(Dimethylamino)Ethyl](Pyridin-3-Ylmethyl)Amine; N',N'-Dimethyl-N-(Pyridin-3-Ylmethyl)Ethane-1,2-Diamine
IUPAC Name N',N'-dimethyl-N-(pyridin-3-ylmethyl)ethane-1,2-diamine
Molecular Weight 179.26
Molecular Formula C10H17N3
InChI XYGQVQONQGFXFY-UHFFFAOYSA-N
InChI Key InChI=1S/C10H17N3/c1-13(2)7-6-12-9-10-4-3-5-11-8-10/h3-5,8,12H,6-7,9H2,1-2H3
Purity 98%
Isomeric SMILES CN(C)CCNCC1=CN=CC=C1
Q&A

What is the chemical formula of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The chemical formula is C10H17N3.

What is the molecular weight of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The molecular weight is 179.26.

What are the synonyms of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The synonyms include N,N-DIMETHYL-N'-PYRIDIN-3-YLMETHYL-ETHANE-1,2-DIAMINE, and 2-(dimethylamino)ethyl][(pyridin-3-yl)methyl]amine.

What is the predicted boiling point of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The predicted boiling point is 277.0±20.0 °C.

What is the predicted pKa value of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The predicted pKa value is 9.22±0.28.

What is the predicted density of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The predicted density is 0.990±0.06 g/cm3.

What are the hazard codes associated with N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The hazard codes are Xi and Xn.

What is the hazard class of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The hazard class is IRRITANT.

What are the risk statements for N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The risk statements include 22.

What is the CAS number of N1,N1-Dimethyl-N2-(pyridin-3-ylmethyl)ethane-1,2-diamine?

The CAS number is 136469-77-7.

Please kindly note that our products and services are for research use only.