N1,N1-Diethylbutane-1,4-diamine

Catalog Number	ACM27431625-1
CAS	27431-62-5
Structure
Synonyms	4-(Diethylamino)butylamine
IUPAC Name	N',N'-diethylbutane-1,4-diamine
Molecular Weight	144.26
Molecular Formula	C8H20N2
InChI	JILXUIANNUALRZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H20N2/c1-3-10(4-2)8-6-5-7-9/h3-9H2,1-2H3
Boiling Point	193.4°C at 760 mmHg
Purity	97%
Appearance	Solid
Isomeric SMILES	CCN(CC)CCCCN

Q&A

What is the chemical formula for N1,N1-Diethylbutane-1,4-diamine?

The chemical formula is C8H20N2.

What is the molecular weight of N1,N1-Diethylbutane-1,4-diamine?

The molecular weight is 144.26.

What is another name for N1,N1-Diethylbutane-1,4-diamine?

Another name is 4-(Diethylamino)butylamine.

Is N1,N1-Diethylbutane-1,4-diamine sensitive to air and moisture?

Yes, it is Air & Moisture Sensitive.

What is the predicted pka value for N1,N1-Diethylbutane-1,4-diamine?

The predicted pka value is 10.48.

At what temperature does N1,N1-Diethylbutane-1,4-diamine melt?

It melts at 156-158 °C.

What is the boiling point of N1,N1-Diethylbutane-1,4-diamine?

The boiling point is 55°C/ 3mm.

How should N1,N1-Diethylbutane-1,4-diamine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What is the water solubility of N1,N1-Diethylbutane-1,4-diamine?

It is slightly soluble in water.

What are the hazard codes and safety statements associated with N1,N1-Diethylbutane-1,4-diamine?

The hazard codes are C,Xn and the safety statements include 26-36/37/39-39.