N1,N1-Diethyl-N2-methylethane-1,2-diamine

Catalog Number	ACM104790-1
CAS	104-79-0
Structure
Synonyms	N,N-Diethyl-N'-methylethylenediamine
IUPAC Name	N',N'-diethyl-N-methylethane-1,2-diamine
Molecular Weight	130.23
Molecular Formula	C7H18N2
InChI	MKDYQLJYEBWUIG-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H18N2/c1-4-9(5-2)7-6-8-3/h8H,4-7H2,1-3H3
Boiling Point	157-160 °C-lit.
Purity	98%
Appearance	Colorless liquid
Isomeric SMILES	CCN(CC)CCNC

Q&A

What is the chemical formula of N,N-Diethyl-N'-methylethylenediamine?

The chemical formula is C7H18N2.

What is the molecular weight of N,N-Diethyl-N'-methylethylenediamine?

The molecular weight is 130.23 g/mol.

What are the product categories that N,N-Diethyl-N'-methylethylenediamine falls under?

It falls under Nitrogen Compounds, Organic Building Blocks, and Polyamines.

What is the boiling point of N,N-Diethyl-N'-methylethylenediamine?

The boiling point is 157-160 °C.

How is N,N-Diethyl-N'-methylethylenediamine stored?

It is stored in the Flammables area.

What is the color of N,N-Diethyl-N'-methylethylenediamine?

It is colorless to almost colorless.

What is the hazard code associated with N,N-Diethyl-N'-methylethylenediamine?

The hazard code is C.

How is N,N-Diethyl-N'-methylethylenediamine classified in WGK Germany?

It is classified as WGK 3.

What are the safety statements associated with N,N-Diethyl-N'-methylethylenediamine?

The safety statements are 16-26-27-36/37/39-45.

What is the main use of N,N-Diethyl-N'-methylethylenediamine?

It is used as a derivatization agent in the quantitative determination of isocyanates by capillary electrophoresis with tris(2,2'-bipyridyl)ruthenium(II) electrochemiluminescence (ECL).