ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N1-Diethyl-3-phenylpropane-1,3-diamine

Catalog Number ACM113640418-1
CAS 113640-41-8
Structure {[CurrentData.Name]}
Synonyms N3,N3-Diethyl-1-Phenyl-1,3-Propanediamine; N3,N3-Diethyl-1-Phenyl-; (3-Amino-3-Phenylpropyl)Diethylamine
IUPAC Name N',N'-diethyl-1-phenylpropane-1,3-diamine
Molecular Weight 206.33
Molecular Formula C13H22N2
InChI KSAIKFIIHCKXGT-UHFFFAOYSA-N
InChI Key InChI=1S/C13H22N2/c1-3-15(4-2)11-10-13(14)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,14H2,1-2H3
Boiling Point 306.0±30.0 °C(Predicted)
Purity 98%
Isomeric SMILES CCN(CC)CCC(C1=CC=CC=C1)N
Q&A

What is the CAS number for N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The CAS number for N1,N1-Diethyl-3-phenylpropane-1,3-diamine is 113640-41-8.

What is the molecular weight of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The molecular weight of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is 206.33.

What are some synonyms for N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

Some synonyms for N1,N1-Diethyl-3-phenylpropane-1,3-diamine are N3,N3-diethyl-1-phenyl-, N',N'-diethyl-1-phenylpropane-1,3-diamine, and N3,N3-Diethyl-1-phenyl-1,3-propanediamine.

What is the molecular formula of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The molecular formula of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is C13H22N2.

What is the predicted boiling point of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The predicted boiling point of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is 306.0±30.0 °C.

What is the predicted pka value of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The predicted pka value of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is 10.27±0.25.

What is the predicted density of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The predicted density of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is 0.953±0.06 g/cm3.

How many nitrogen atoms are present in the molecular formula of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

There are two nitrogen atoms present in the molecular formula of N1,N1-Diethyl-3-phenylpropane-1,3-diamine.

What is the chemical structure of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

The chemical structure of N1,N1-Diethyl-3-phenylpropane-1,3-diamine is C6H5NHC(CH3)2NHEt2.

What are some potential uses of N1,N1-Diethyl-3-phenylpropane-1,3-diamine?

N1,N1-Diethyl-3-phenylpropane-1,3-diamine can potentially be used as a chemical intermediate in the synthesis of other compounds or in organic reactions.

Please kindly note that our products and services are for research use only.