N1,N1-Dibutylpropane-1,3-diamine

Catalog Number	ACM102830-3
CAS	102-83-0
Structure
Synonyms	3-(Dibutylamino)propylamine
IUPAC Name	N',N'-dibutylpropane-1,3-diamine
Molecular Weight	186.34
Molecular Formula	C11H26N2
InChI	KYCGURZGBKFEQB-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H26N2/c1-3-5-9-13(10-6-4-2)11-7-8-12/h3-12H2,1-2H3
Boiling Point	205 °C - lit.
Purity	97%
Appearance	Liquid
Isomeric SMILES	CCCCN(CCCC)CCCN

Q&A

What is the chemical formula for N,N-Dibutyl-1,3-propanediamine?

The chemical formula is C11H26N2.

What is the molecular weight of N,N-Dibutyl-1,3-propanediamine?

The molecular weight is 186.34.

What is the melting point of N,N-Dibutyl-1,3-propanediamine?

The melting point is -50 °C.

What is the density of N,N-Dibutyl-1,3-propanediamine at 25 °C?

The density is 0.827 g/mL at 25 °C.

Is N,N-Dibutyl-1,3-propanediamine air sensitive?

Yes, it is air sensitive.

What is the boiling point of N,N-Dibutyl-1,3-propanediamine?

The boiling point is 205 °C.

What is the water solubility of N,N-Dibutyl-1,3-propanediamine at 20 °C?

The water solubility is 10 g/L at 20 °C.

What are the hazard codes associated with N,N-Dibutyl-1,3-propanediamine?

The hazard codes are C and Xi.

How should N,N-Dibutyl-1,3-propanediamine be stored?

It should be kept in a dark place, in an inert atmosphere, at room temperature.

What is the toxicity of N,N-Dibutyl-1,3-propanediamine in rabbits according to the reference?

The LD50 for skin exposure in rabbits is 270 uL/kg (0.27 mL/kg).