N1-Methyl-N1-phenylbutane-1,4-diamine

Catalog Number	ACM146426020
CAS	146426-02-0
Synonyms	N-(4-Aminobutyl)-N-Methylaniline
IUPAC Name	N'-methyl-N'-phenylbutane-1,4-diamine
Molecular Weight	178.27
Molecular Formula	C11H18N2
InChI	JLEMNVMHZPEHBM-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H18N2/c1-13(10-6-5-9-12)11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10,12H2,1H3
Purity	98%
Isomeric SMILES	CN(CCCCN)C1=CC=CC=C1

Q&A

What is the CAS number for N1-Methyl-N1-phenylbutane-1,4-diamine?

The CAS number for N1-Methyl-N1-phenylbutane-1,4-diamine is 146426-02-0.

What is the molecular weight of N1-Methyl-N1-phenylbutane-1,4-diamine?

The molecular weight of N1-Methyl-N1-phenylbutane-1,4-diamine is 178.27.

What are some synonyms for N1-Methyl-N1-phenylbutane-1,4-diamine?

Some synonyms for N1-Methyl-N1-phenylbutane-1,4-diamine include N1-Methyl-N1-phenylbutane-1,4-diamine and 1,4-Butanediamine, N1-methyl-N1-phenyl-.

What is the molecular formula of N1-Methyl-N1-phenylbutane-1,4-diamine?

The molecular formula of N1-Methyl-N1-phenylbutane-1,4-diamine is C11H18N2.

What is the predicted boiling point of N1-Methyl-N1-phenylbutane-1,4-diamine?

The predicted boiling point of N1-Methyl-N1-phenylbutane-1,4-diamine is 288.0±23.0 °C.

How should N1-Methyl-N1-phenylbutane-1,4-diamine be stored?

N1-Methyl-N1-phenylbutane-1,4-diamine should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of N1-Methyl-N1-phenylbutane-1,4-diamine?

The predicted density of N1-Methyl-N1-phenylbutane-1,4-diamine is 0.986±0.06 g/cm3.

What is the predicted pKa value of N1-Methyl-N1-phenylbutane-1,4-diamine?

The predicted pKa value of N1-Methyl-N1-phenylbutane-1,4-diamine is 10.48±0.10.

What are the conditions recommended for optimal storage of N1-Methyl-N1-phenylbutane-1,4-diamine?

The optimal storage conditions for N1-Methyl-N1-phenylbutane-1,4-diamine include under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted boiling point range for N1-Methyl-N1-phenylbutane-1,4-diamine?

The predicted boiling point range for N1-Methyl-N1-phenylbutane-1,4-diamine is 288.0±23.0 °C.