N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide

Catalog Number	ACM428840157
CAS	428840-15-7
Synonyms	Ethanediamide, N1-(2-furanylmethyl)-N2-1-naphthalenyl-
IUPAC Name	N-(furan-2-ylmethyl)-N'-naphthalen-1-yloxamide
Molecular Weight	294.30
Molecular Formula	C17H14N2O3
InChI	LDANCNUGGDSEJY-UHFFFAOYSA-N
InChI Key	InChI=1S/C17H14N2O3/c20-16(18-11-13-7-4-10-22-13)17(21)19-15-9-3-6-12-5-1-2-8-14(12)15/h1-10H,11H2,(H,18,20)(H,19,21)
Purity	97%
Isomeric SMILES	C1=CC=C2C(=C1)C=CC=C2NC(=O)C(=O)NCC3=CC=CO3

Q&A

What is the molecular weight of N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The molecular weight is 294.3.

What is the synonym for N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The synonym is Ethanediamide, N1-(2-furanylmethyl)-N2-1-naphthalenyl-.

What is the predicted density of N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The predicted density is 1.322±0.06 g/cm3.

What is the predicted pka of N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The predicted pka is 11.53±0.30.

What is the molecular formula of N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The molecular formula is C17H14N2O3.

What is the CAS number of N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The CAS number is 428840-15-7.

In what form is N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide predicted to exist?

It is predicted to exist in the form of oxalamide.

What are the two main functional groups present in N1-(Furan-2-ylmethyl)-N2-(naphthalen-1-yl)oxalamide?

The two functional groups are furan and naphthalene.