What is the IUPAC name of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The IUPAC name of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is dicyclohexyl-(1-phenylpyrrol-2-yl)phosphane.
What is the molecular formula of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The molecular formula of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is C22H30NP.
What is the exact mass of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The exact mass of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is 339.211586959.
How many hydrogen bond acceptors are present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
There are 0 hydrogen bond acceptors present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole.
What is the Canonical SMILES representation of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The Canonical SMILES representation of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is C1CCC(CC1)P(C2CCCCC2)C3=CC=CN3C4=CC=CC=C4.
What is the Monoisotopic Mass of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The Monoisotopic Mass of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is 339.211586959.
How many heavy atoms are present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
There are 24 heavy atoms present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole.
What is the CAS number of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The CAS number of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is 672937-60-9.
How many rotatable bonds are present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
There are 4 rotatable bonds present in N-Phenyl-2-(dicyclohexylphosphino)pyrrole.
What is the topological polar surface area of N-Phenyl-2-(dicyclohexylphosphino)pyrrole?
The topological polar surface area of N-Phenyl-2-(dicyclohexylphosphino)pyrrole is 4.9.