What is the CAS number of the compound N-Phenyl-2-(dicyclohexylphosphino)indol?
The CAS number is 740815-36-5.
What is the molecular weight of N-Phenyl-2-(dicyclohexylphosphino)indol?
The molecular weight is 389.5g/mol.
What is the exact mass of N-Phenyl-2-(dicyclohexylphosphino)indol?
The exact mass is 389.227237023.
How many hydrogen bond acceptor count does N-Phenyl-2-(dicyclohexylphosphino)indol have?
It has 0 hydrogen bond acceptor count.
What is the Canonical SMILES of N-Phenyl-2-(dicyclohexylphosphino)indol?
C1CCC(CC1)P(C2CCCCC2)C3=CC4=CC=CC=C4N3C5=CC=CC=C5
What is the IUPAC Name of N-Phenyl-2-(dicyclohexylphosphino)indol?
The IUPAC Name is dicyclohexyl-(1-phenylindol-2-yl)phosphane.
How many computed properties defined atom stereocenter count does N-Phenyl-2-(dicyclohexylphosphino)indol have?
It has 0 computed properties defined atom stereocenter count.
What is the InChIKey of N-Phenyl-2-(dicyclohexylphosphino)indol?
The InChIKey is TZWPHBJJVRIXMS-UHFFFAOYSA-N.
What is the molecular formula of N-Phenyl-2-(dicyclohexylphosphino)indol?
The molecular formula is C26H32NP.
What are some of the depositor-supplied synonyms for N-Phenyl-2-(dicyclohexylphosphino)indol?
Some of the synonyms include 2-(DICYCLOHEXYLPHOSPHINO)-1-PHENYLINDOLE, BP-12238, and N-phenyl-2-(dicyclohexyl-phosphino)indole.