ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N-Phenyl-2-(di-t-butylphosphino)pyrrole

Catalog Number ACM672937610-2
CAS 672937-61-0
Structure {[CurrentData.Name]}
Synonyms 1-Phenyl-2-(Di-Tert-Butyl-Phosphino)-1H-Pyrrole
Molecular Weight 287.38
Molecular Formula C18H26NP
Boiling Point 386.3±15.0 °C(Predicted)
Melting Point 51 °C
Purity 98%
Appearance Solid
pKa -6.07±0.70(Predicted)
Type cataCXium
Q&A

What is the IUPAC name of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The IUPAC name of N-Phenyl-2-(di-t-butylphosphino)pyrrole is ditert-butyl-(1-phenylpyrrol-2-yl)phosphane.

What is the molecular formula of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The molecular formula of N-Phenyl-2-(di-t-butylphosphino)pyrrole is C18H26NP.

What is the exact mass of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The exact mass of N-Phenyl-2-(di-t-butylphosphino)pyrrole is 287.180286831.

How many heavy atoms are present in N-Phenyl-2-(di-t-butylphosphino)pyrrole?

There are 20 heavy atoms present in N-Phenyl-2-(di-t-butylphosphino)pyrrole.

How many rotatable bonds are present in N-Phenyl-2-(di-t-butylphosphino)pyrrole?

There are 4 rotatable bonds present in N-Phenyl-2-(di-t-butylphosphino)pyrrole.

What is the canonical SMILES representation of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The canonical SMILES representation of N-Phenyl-2-(di-t-butylphosphino)pyrrole is CC(C)(C)P(C1=CC=CN1C2=CC=CC=C2)C(C)(C)C.

What is the CAS number of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The CAS number of N-Phenyl-2-(di-t-butylphosphino)pyrrole is 672937-61-0.

How many hydrogen bond acceptors are present in N-Phenyl-2-(di-t-butylphosphino)pyrrole?

There are 0 hydrogen bond acceptors present in N-Phenyl-2-(di-t-butylphosphino)pyrrole.

What is the topological polar surface area of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The topological polar surface area of N-Phenyl-2-(di-t-butylphosphino)pyrrole is 4.9.

What is the InChIKey of N-Phenyl-2-(di-t-butylphosphino)pyrrole?

The InChIKey of N-Phenyl-2-(di-t-butylphosphino)pyrrole is DVVDGSKDQGMLPW-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.