N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)

Catalog Number	ACM154883019-1
CAS	154883-01-9
Synonyms	Tributylmethylaminium Hexafluorophosphate
IUPAC Name	tributyl(methyl)azanium;hexafluorophosphate
Molecular Weight	345.35
Molecular Formula	C13H30F6NP
InChI	XDGFEAFWBLXDPR-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H30N.F6P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-7(2,3,4,5)6/h5-13H2,1-4H3;/q+1;-1
Purity	98%
Isomeric SMILES	CCCC[N+](C)(CCCC)CCCC.F[P-](F)(F)(F)(F)F

Q&A

What is the molecular formula of N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The molecular formula is C13H30F6NP.

What is the IUPAC name of N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The IUPAC name is tributyl(methyl)azanium; hexafluorophosphate.

What is the Canonical SMILES representation of N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The Canonical SMILES representation is CCCC[N+](C)(CCCC)CCCC.F[P-](F)(F)(F)(F)F.

What is the exact mass of N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The exact mass is 345.20200593.

How many heavy atoms are present in the compound?

There are 21 heavy atoms.

What is the Depositor-Supplied Synonym for the compound?

The Depositor-Supplied Synonym is tributylmethylammomium hexafluorophosphate.

How many hydrogen bond acceptors are there in N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

There are 7 hydrogen bond acceptors.

What is the InChIKey for N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The InChIKey is XDGFEAFWBLXDPR-UHFFFAOYSA-N.

How many rotatable bonds are present in the compound?

There are 9 rotatable bonds.

What is the molecular weight of N,N-Dibutyl-N-methylbutan-1-aminium hexafluorophosphate(V)?

The molecular weight is 345.35g/mol.