Methyldiphenylphsphine

Catalog Number	ACM1486288-1
CAS	1486-28-8
Structure
Synonyms	Diphenylphosphinomethane
IUPAC Name	methyl(diphenyl)phosphane
Molecular Weight	200.22
Molecular Formula	C13H13P
InChI	UJNZOIKQAUQOCN-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H13P/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3
Boiling Point	120-122 °C at 1.5 mmHg(lit.)
Melting Point	117-118 °C
Flash Point	>230 °F
Purity	98%
Density	1.076 g/mL at 25 °C(lit.)
Appearance	Liquid
Isomeric SMILES	CP(C1=CC=CC=C1)C2=CC=CC=C2

Q&A

What is the CAS number of Methyldiphenylphosphine?

The CAS number of Methyldiphenylphosphine is 1486-28-8.

What is the molecular formula of Methyldiphenylphosphine?

The molecular formula of Methyldiphenylphosphine is C13H13P.

What is the molecular weight of Methyldiphenylphosphine?

The molecular weight of Methyldiphenylphosphine is 200.22g/mol.

How many heavy atoms are present in Methyldiphenylphosphine?

Methyldiphenylphosphine contains 14 heavy atoms.

What is the Canonical SMILES of Methyldiphenylphosphine?

The Canonical SMILES of Methyldiphenylphosphine is CP(C1=CC=CC=C1)C2=CC=CC=C2.

How many rotatable bonds are there in Methyldiphenylphosphine?

Methyldiphenylphosphine has 2 rotatable bonds.

What is the IUPAC name of Methyldiphenylphosphine?

The IUPAC name of Methyldiphenylphosphine is methyl(diphenyl)phosphane.

What is the InChIKey of Methyldiphenylphosphine?

The InChIKey of Methyldiphenylphosphine is UJNZOIKQAUQOCN-UHFFFAOYSA-N.

How many atom stereocenters are defined in Methyldiphenylphosphine?

There are 0 defined atom stereocenters in Methyldiphenylphosphine.

What is the UNII number of Methyldiphenylphosphine?

The UNII number of Methyldiphenylphosphine is RYN4FS3JEN.