Methyldiphenylphosphine oxide

Catalog Number	ACM2129897-2
CAS	2129-89-7
Structure
Synonyms	Diphenylmethylphosphine Oxide
IUPAC Name	[methyl(phenyl)phosphoryl]benzene
Molecular Weight	216.22
Molecular Formula	C13H13OP
InChI	PEGCITODQASXKH-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H13OP/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3
Boiling Point	180 °C at 1 mmHg
Melting Point	111-115 °C(lit.)
Purity	98%
Density	1.12±0.1 g/cm3(Predicted)
Appearance	Solid
Isomeric SMILES	CP(=O)(C1=CC=CC=C1)C2=CC=CC=C2

Q&A

What is the CAS number for Methyldiphenylphosphine oxide?

The CAS number for Methyldiphenylphosphine oxide is 2129-89-7.

What is the molecular formula of Methyldiphenylphosphine oxide?

The molecular formula of Methyldiphenylphosphine oxide is C13H13OP.

What is the IUPAC name of Methyldiphenylphosphine oxide?

The IUPAC name of Methyldiphenylphosphine oxide is [methyl(phenyl)phosphoryl]benzene.

How many heavy atoms are present in Methyldiphenylphosphine oxide?

There are 15 heavy atoms present in Methyldiphenylphosphine oxide.

What is the topological polar surface area of Methyldiphenylphosphine oxide?

The topological polar surface area of Methyldiphenylphosphine oxide is 17.1.

What is the XLogP3 value of Methyldiphenylphosphine oxide?

The XLogP3 value of Methyldiphenylphosphine oxide is 1.3.

What is the exact mass of Methyldiphenylphosphine oxide?

The exact mass of Methyldiphenylphosphine oxide is 216.070402032.

What is the molecular weight of Methyldiphenylphosphine oxide?

The molecular weight of Methyldiphenylphosphine oxide is 216.21g/mol.

What is the InChIKey of Methyldiphenylphosphine oxide?

The InChIKey of Methyldiphenylphosphine oxide is PEGCITODQASXKH-UHFFFAOYSA-N.

Are there any synonyms for Methyldiphenylphosphine oxide?

Yes, some of the synonyms for Methyldiphenylphosphine oxide include methyl(diphenyl)phosphine oxide, Diphenylmethylphosphine oxide, and [methyl(phenyl)phosphoroso]benzene.