| Catalog Number |
ACM14609542-6 |
| CAS |
14609-54-2 |
| Structure |
 |
| Description |
Meso-Tetra(4-carboxyphenyl)porphine, also known as T4CP, is a porphyrin-based compound that has a wide range of applications in scientific research. It is composed of four pyrrole rings and a central carboxyl group, and is a member of the family of porphyrins known as tetrapyrroles. T4CP is a versatile molecule that can be used in a variety of scientific experiments due to its unique structure and properties. |
| Synonyms |
4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis-benzoicacid |
| IUPAC Name |
4-[10,15,20-tris(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| Molecular Weight |
790.8 g/mol |
| Molecular Formula |
C48H30N4O8 |
| Canonical SMILES |
C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=C(C=C9)C(=O)O)N3)C(=O)O
Canonical SMILES: C1=CC(=CC=C1C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C9=CC=C(C=C9)C(=O)O)N3)C(=O)O |
| InChI |
InChI=1S/C48H30N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChI Key |
SMOZAZLNDSFWAB-UHFFFAOYSA-N |
| Melting Point |
>300 °C |
| Purity |
97% |
| Density |
1.462 ± 0.06 g/ml |
| Solubility |
In water, 2.87X10-10 mg/L at 25 °C (est) |
| Appearance |
Purple solid |
| Application |
Meso-Tetra(4-carboxyphenyl)porphine has a wide range of applications in scientific research. It has been used as a model compound for studying the structure, function, and reactivity of porphyrins in biological systems. Additionally, it has been used as a fluorescent probe for imaging and detection of biomolecules. It has also been used in the development of new drugs, as well as in the study of enzyme-catalyzed reactions. |
| Storage |
Room temperature |
| Complexity |
1310 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
790.20636393g/mol |
| Heavy Atom Count |
60 |
| Hydrogen Bond Acceptor Count |
10 |
| Hydrogen Bond Donor Count |
6 |
| Monoisotopic Mass |
790.20636393g/mol |
| Properties |
Meso-Tetra(4-carboxyphenyl)porphine can have a variety of biochemical and physiological effects. It has been shown to interact with proteins and enzymes, leading to changes in their structure and function. Additionally, it has been shown to interact with DNA, which can lead to changes in gene expression. Additionally, it has been shown to be toxic to certain types of bacteria and fungi, which can be beneficial in certain applications. |
| Rotatable Bond Count |
8 |
| Topological Polar Surface Area |
207Ų |
