Magnesium meso-tetraphenylporphine

Catalog Number	ACM24968227
CAS	24968-22-7
Synonyms	Magnesium;5,10,15,20-tetraphenylporphyrin-22,24-diide;hydrate
Molecular Weight	655.04
Molecular Formula	C44H30MgN4O
Canonical SMILES	C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.O.[Mg+2]
InChI	InChI=1S/C44H28N4.Mg.H2O/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;1H2/q-2;+2;
InChI Key	VTAVIQZTEKZUJO-UHFFFAOYSA-N
Purity	97%
Exact Mass	654.2270033
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Monoisotopic Mass	654.2270033
Rotatable Bond Count	4
Topological Polar Surface Area	27.7 Ų

Q&A

What is the chemical formula of Magnesium meso-tetraphenylporphine?

The chemical formula of Magnesium meso-tetraphenylporphine is MF:C44H28MgN4.

What are the synonyms of Magnesium meso-tetraphenylporphine?

Some synonyms of Magnesium meso-tetraphenylporphine include 5,10,15,20-Tetraphenyl-21H,23H-porphine magnesium(II), Magnesium(II) Meso-Tetraphenylporphine, and Magnesium meso-Tetraphenylporphine n-hydrate.

What is the molecular weight of Magnesium meso-tetraphenylporphine?

The molecular weight of Magnesium meso-tetraphenylporphine is 637.02 g/mol.

What is the solubility of Magnesium meso-tetraphenylporphine in DMSO?

Magnesium meso-tetraphenylporphine is very slightly soluble in DMSO.

What is the color of Magnesium meso-tetraphenylporphine?

The color of Magnesium meso-tetraphenylporphine is purple.

What form does Magnesium meso-tetraphenylporphine come in?

Magnesium meso-tetraphenylporphine comes in crystal form.

Is Magnesium meso-tetraphenylporphine stable under light?

No, Magnesium meso-tetraphenylporphine is light sensitive.

What is the main use of Magnesium meso-tetraphenylporphine monohydrate?

Magnesium meso-tetraphenylporphine monohydrate is a magnesium bound porphyrin derivative.

In which product category does Magnesium meso-tetraphenylporphine belong?

Magnesium meso-tetraphenylporphine belongs in the metal porphine (porphyrin) complex product category.