Magnesium ascorbate

Catalog Number	ACM15431400-2
CAS	15431-40-0
Structure
Synonyms	Ascorbic acid, magnesium salt
Molecular Weight	374.54
Molecular Formula	C12H14MgO12
Canonical SMILES	C(C(C1C(=C(C(=O)O1)[O-])O)O)O.C(C(C1C(=C(C(=O)O1)[O-])O)O)O.[Mg+2]
InChI	InChI=1S/2C6H8O6.Mg/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;/h2*2,5,7-10H,1H2;/q;+2/p-2/t2*2-,5+;/m00./s1
InChI Key	AIOKQVJVNPDJKA-ZZMNMWMASA-L
Purity	99%
Appearance	Powder
Exact Mass	374.0335676
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	6
Isomeric SMILES	C([C@@H]([C@@H]1C(=C(C(=O)O1)[O-])O)O)O.C([C@@H]([C@@H]1C(=C(C(=O)O1)[O-])O)O)O.[Mg+2]
Monoisotopic Mass	374.0335676
Rotatable Bond Count	4
Topological Polar Surface Area	220

Q&A

What is the molecular weight of magnesium ascorbate?

The molecular weight of magnesium ascorbate is 374.54.

What is the product name of magnesium ascorbate?

The product name of magnesium ascorbate is (+)-MAGNESIUM L-ASCORBATE.

What are some synonyms for magnesium ascorbate?

Some synonyms for magnesium ascorbate are VITAMIN C MAGNESIUM SALT, MAGNESIUM ASCORBATE, L(+)-ASCORBIC ACID MAGNESIUM SALT, and Ascorbic acid, magnesium salt.

What is the molecular formula of magnesium ascorbate?

The molecular formula of magnesium ascorbate is C12H14MgO12.

What is the EINECS number of magnesium ascorbate?

The EINECS number of magnesium ascorbate is 239-442-6.

What safety statements are associated with magnesium ascorbate?

The safety statements associated with magnesium ascorbate are 22-24/25.

What is the fire hazard class of magnesium ascorbate?

The fire hazard class of magnesium ascorbate is 3.

What is the water hazard class in Germany for magnesium ascorbate?

The water hazard class in Germany for magnesium ascorbate is 3.

How does magnesium ascorbate exist in terms of its molecular structure?

Magnesium ascorbate exists as a salt form of ascorbic acid and magnesium.

What is the role of magnesium in magnesium ascorbate?

Magnesium in magnesium ascorbate serves as a mineral supplement and helps in the absorption of ascorbic acid.