Indene

Catalog Number	ACM95136-1
CAS	95-13-6
Structure
Synonyms	1H-Indene
IUPAC Name	1H-indene
Molecular Weight	116.16
Molecular Formula	C9H8
InChI	YBYIRNPNPLQARY-UHFFFAOYSA-N
InChI Key	InChI=1S/C9H8/c1-2-5-9-7-3-6-8(9)4-1/h1-6H,7H2
Boiling Point	181-182 °C(lit.)
Melting Point	−5-−3 °C(lit.)
Purity	98%
Density	0.996 g/cm3 at 25 °C(lit.)
Appearance	Colorless to yellow liquid
Complexity	124
Defined Atom Stereocenter Count	0
Exact Mass	116.0626
Formal Charge	0
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C=CC2=CC=CC=C21
Monoisotopic Mass	116.0626
Rotatable Bond Count	0
Topological Polar Surface Area	0 Ų

Q&A

What is the PubChem CID of indene?

The PubChem CID of indene is 7219.

What is the molecular formula of indene?

The molecular formula of indene is C9H8.

Is indene soluble in water?

No, indene is insoluble in water.

What is the boiling point of indene?

The boiling point of indene is 182 °C.

What is the density of indene?

The density of indene is 0.997 g cm-3.

Is indene a natural product?

Yes, indene is a natural product found in Vaccinium macrocarpon, Terminalia chebula, and other organisms.

What is the IUPAC name of indene?

The IUPAC name of indene is 1H-indene.

What is the InChIKey of indene?

The InChIKey of indene is YBYIRNPNPLQARY-UHFFFAOYSA-N.

What is the CAS number of indene?

The CAS number of indene is 95-13-6.

What is the molecular weight of indene?

The molecular weight of indene is 116.16 g/mol.