Ferrous acetylacetonate

Catalog Number	ACM14024170-3
CAS	14024-17-0
Structure
Synonyms	Iron acetylacetonate
Molecular Weight	256.08
Molecular Formula	C10H16FeO4
Canonical SMILES	CC(=CC(=O)C)O.CC(=CC(=O)C)O.[Fe]
InChI	InChI=1S/2C5H8O2.Fe/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-;
InChI Key	LFKXWKGYHQXRQA-FDGPNNRMSA-N
Melting Point	175 °C
Purity	99%+
Appearance	Powder
Exact Mass	256.039795
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C(=C/C(=O)C)/O.C/C(=C/C(=O)C)/O.[Fe]
Monoisotopic Mass	256.039795
Rotatable Bond Count	2
Topological Polar Surface Area	74.6 Ų

Q&A

What is the molecular formula of ferrous acetylacetonate?

The molecular formula of ferrous acetylacetonate is C10H16FeO4.

What are the synonyms for ferrous acetylacetonate?

The synonyms for ferrous acetylacetonate include Iron acetylacetonate, Iron(II) acetylacetonate, and Iron acetylacetonate hydrate.

What is the CAS number of ferrous acetylacetonate?

The CAS number of ferrous acetylacetonate is 14024-17-0.

What is the IUPAC name of ferrous acetylacetonate?

The IUPAC name of ferrous acetylacetonate is (Z)-4-hydroxypent-3-en-2-one;iron.

What is the InChI code of ferrous acetylacetonate?

The InChI code of ferrous acetylacetonate is InChI=1S/2C5H8O2.Fe/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-.

What is the molecular weight of ferrous acetylacetonate?

The molecular weight of ferrous acetylacetonate is 256.08g/mol.

How many hydrogen bond donor counts are there in ferrous acetylacetonate?

There are 2 hydrogen bond donor counts in ferrous acetylacetonate.

How many hydrogen bond acceptor counts are there in ferrous acetylacetonate?

There are 4 hydrogen bond acceptor counts in ferrous acetylacetonate.

How many rotatable bond counts are there in ferrous acetylacetonate?

There are 2 rotatable bond counts in ferrous acetylacetonate.

Is ferrous acetylacetonate a canonicalized compound?

Yes, ferrous acetylacetonate is a canonicalized compound.