Diphenylchlorophosphine

Catalog Number	ACM1079669-1
CAS	1079-66-9
Structure
Synonyms	Chlorodiphenylphosphine
IUPAC Name	chloro(diphenyl)phosphane
Molecular Weight	220.63
Molecular Formula	C12H10ClP
InChI	XGRJZXREYAXTGV-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
Boiling Point	320 °C(lit.)
Melting Point	14-16 °C
Flash Point	>230 °F
Purity	98%
Density	1.229 g/mL at 25 °C(lit.)
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)Cl

Q&A

What is the molecular formula of Diphenylchlorophosphine?

The molecular formula of Diphenylchlorophosphine is C12H10ClP.

What is the IUPAC name of Diphenylchlorophosphine?

The IUPAC name of Diphenylchlorophosphine is chloro(diphenyl)phosphane.

What is the CAS number of Diphenylchlorophosphine?

The CAS number of Diphenylchlorophosphine is 1079-66-9.

What is the molecular weight of Diphenylchlorophosphine?

The molecular weight of Diphenylchlorophosphine is 220.63 g/mol.

How many hydrogen bond acceptors does Diphenylchlorophosphine have?

Diphenylchlorophosphine has 0 hydrogen bond acceptors.

What is the Canonical SMILES of Diphenylchlorophosphine?

The Canonical SMILES of Diphenylchlorophosphine is C1=CC=C(C=C1)P(C2=CC=CC=C2)Cl.

What is the XLogP3 value of Diphenylchlorophosphine?

The XLogP3 value of Diphenylchlorophosphine is 3.8.

What is the InChIKey of Diphenylchlorophosphine?

The InChIKey of Diphenylchlorophosphine is XGRJZXREYAXTGV-UHFFFAOYSA-N.

What are some other synonyms for Diphenylchlorophosphine?

Some other synonyms for Diphenylchlorophosphine are Diphenylphosphinous chloride, Phosphinous chloride, diphenyl-, P-Chlorodiphenylphosphine, and more.

What is the exact mass of Diphenylchlorophosphine?

The exact mass of Diphenylchlorophosphine is 220.0208650.