ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Diphenylchlorophosphine

Catalog Number ACM1079669-1
CAS 1079-66-9
Structure {[CurrentData.Name]}
Synonyms Chlorodiphenylphosphine
IUPAC Name chloro(diphenyl)phosphane
Molecular Weight 220.63
Molecular Formula C12H10ClP
InChI XGRJZXREYAXTGV-UHFFFAOYSA-N
InChI Key InChI=1S/C12H10ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
Boiling Point 320 °C(lit.)
Melting Point 14-16 °C
Flash Point >230 °F
Purity 98%
Density 1.229 g/mL at 25 °C(lit.)
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)Cl
Q&A

What is the molecular formula of Diphenylchlorophosphine?

The molecular formula of Diphenylchlorophosphine is C12H10ClP.

What is the IUPAC name of Diphenylchlorophosphine?

The IUPAC name of Diphenylchlorophosphine is chloro(diphenyl)phosphane.

What is the CAS number of Diphenylchlorophosphine?

The CAS number of Diphenylchlorophosphine is 1079-66-9.

What is the molecular weight of Diphenylchlorophosphine?

The molecular weight of Diphenylchlorophosphine is 220.63 g/mol.

How many hydrogen bond acceptors does Diphenylchlorophosphine have?

Diphenylchlorophosphine has 0 hydrogen bond acceptors.

What is the Canonical SMILES of Diphenylchlorophosphine?

The Canonical SMILES of Diphenylchlorophosphine is C1=CC=C(C=C1)P(C2=CC=CC=C2)Cl.

What is the XLogP3 value of Diphenylchlorophosphine?

The XLogP3 value of Diphenylchlorophosphine is 3.8.

What is the InChIKey of Diphenylchlorophosphine?

The InChIKey of Diphenylchlorophosphine is XGRJZXREYAXTGV-UHFFFAOYSA-N.

What are some other synonyms for Diphenylchlorophosphine?

Some other synonyms for Diphenylchlorophosphine are Diphenylphosphinous chloride, Phosphinous chloride, diphenyl-, P-Chlorodiphenylphosphine, and more.

What is the exact mass of Diphenylchlorophosphine?

The exact mass of Diphenylchlorophosphine is 220.0208650.

Please kindly note that our products and services are for research use only.