Diphenyl(tert-butyl)phosphine

Catalog Number	ACM6002342-1
CAS	6002-34-2
Structure
Synonyms	Tert-Butyldiphenylphosphine
IUPAC Name	tert-butyl(diphenyl)phosphane
Molecular Weight	242.30
Molecular Formula	C16H19P
InChI	QZUPHAGRBBOLTB-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H19P/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3
Boiling Point	144-146 °C at 2 mmHg(lit.)
Melting Point	52-55 °C(lit.)
Flash Point	>230 °F
Purity	98%
Appearance	Solid
Isomeric SMILES	CC(C)(C)P(C1=CC=CC=C1)C2=CC=CC=C2

Q&A

What is the CAS number for Diphenyl(tert-butyl)phosphine?

The CAS number for Diphenyl(tert-butyl)phosphine is 6002-34-2.

How many heavy atoms are present in the Diphenyl(tert-butyl)phosphine molecule?

There are 17 heavy atoms present in the Diphenyl(tert-butyl)phosphine molecule.

What is the molecular formula of Diphenyl(tert-butyl)phosphine?

The molecular formula of Diphenyl(tert-butyl)phosphine is C16H19P.

What is the name of the compound with the IUPAC name tert-butyl(diphenyl)phosphane?

The compound with the IUPAC name tert-butyl(diphenyl)phosphane is Diphenyl(tert-butyl)phosphine.

What is the Exact Mass of Diphenyl(tert-butyl)phosphine?

The exact mass of Diphenyl(tert-butyl)phosphine is 242.122437604.

How many rotatable bond counts are there in the Diphenyl(tert-butyl)phosphine molecule?

There are 3 rotatable bond counts in the Diphenyl(tert-butyl)phosphine molecule.

What is the Computed Properties Covalently-Bonded Unit Count of Diphenyl(tert-butyl)phosphine?

The Computed Properties Covalently-Bonded Unit Count of Diphenyl(tert-butyl)phosphine is 1.

What is the Canonical SMILES representation of Diphenyl(tert-butyl)phosphine?

The Canonical SMILES representation of Diphenyl(tert-butyl)phosphine is CC(C)(C)P(C1=CC=CC=C1)C2=CC=CC=C2.

How many hydrogen bond acceptor counts are there in the Diphenyl(tert-butyl)phosphine molecule?

There are 0 hydrogen bond acceptor counts in the Diphenyl(tert-butyl)phosphine molecule.

What is the Deposition-Supplied Synonym for Diphenyl(tert-butyl)phosphine that is not a CAS number or ChemSpider ID?

The Deposition-Supplied Synonym for Diphenyl(tert-butyl)phosphine that is not a CAS number or ChemSpider ID is tert-butyldiphenylphosphane.