Diphenyl azidophosphate

Catalog Number	ACM26386889-1
CAS	26386-88-9
Structure
Synonyms	Phosphoric acid diphenyl ester azide; DPPA
IUPAC Name	[azido(phenoxy)phosphoryl]oxybenzene
Molecular Weight	275.20
Molecular Formula	C12H10N3O3P
InChI	SORGEQQSQGNZFI-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10N3O3P/c13-14-15-19(16,17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10H
Boiling Point	157 °C at 0.17 mmHg (lit.)
Flash Point	>230 °F
Purity	97%
Density	1.277 g/mL at 25 °C (lit.)
Appearance	Liquid
Isomeric SMILES	C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2

Q&A

What is the molecular formula of Diphenyl azidophosphate?

The molecular formula of Diphenyl azidophosphate is C12H10N3O3P.

What is the CAS number of Diphenyl azidophosphate?

The CAS number of Diphenyl azidophosphate is 26386-88-9.

What are some Depositor-Supplied Synonyms for Diphenyl azidophosphate?

Some Depositor-Supplied Synonyms for Diphenyl azidophosphate include Diphenylphosphoryl azide, DPPA, and diphenyl phosphorazidate.

What is the canonical SMILES representation of Diphenyl azidophosphate?

The canonical SMILES representation of Diphenyl azidophosphate is C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2.

What is the IUPAC Name of Diphenyl azidophosphate?

The IUPAC Name of Diphenyl azidophosphate is [azido(phenoxy)phosphoryl]oxybenzene.

What is the exact mass of Diphenyl azidophosphate?

The exact mass of Diphenyl azidophosphate is 275.04597819.

How many heavy atoms are present in Diphenyl azidophosphate?

There are 19 heavy atoms present in Diphenyl azidophosphate.

How many rotatable bonds are present in the structure of Diphenyl azidophosphate?

There are 5 rotatable bonds present in the structure of Diphenyl azidophosphate.

What is the topological polar surface area of Diphenyl azidophosphate?

The topological polar surface area of Diphenyl azidophosphate is 49.9.

What is the Wikipedia entry term for Diphenyl azidophosphate?

The Wikipedia entry term for Diphenyl azidophosphate is Diphenylphosphoryl_azide.