ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Diphenyl[4-(trifluoromethyl)phenyl]phosphine

Catalog Number ACM13406285
CAS 13406-28-5
Molecular Weight 330.28
Molecular Formula C19H14F3P
Melting Point 55-57 °C
Appearance Solid
Q&A

What is the molecular formula of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

The molecular formula is C19H14F3P.

What is the exact mass of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

The exact mass is 330.07852193.

What is the IUPAC name of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

The IUPAC name is diphenyl-[4-(trifluoromethyl)phenyl]phosphane.

How many heavy atoms are present in the structure of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

There are 23 heavy atoms.

What is the XLogP3 value of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

The XLogP3 value is 5.5.

Is Diphenyl[4-(trifluoromethyl)phenyl]phosphine a hydrogen bond acceptor?

Yes, it has 3 hydrogen bond acceptors.

What is the canonical SMILES notation for Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)C(F)(F)F

What is the InChIKey for Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

XDRGHRGPMXAABY-UHFFFAOYSA-N

How many rotatable bonds are there in the structure of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

There are 3 rotatable bonds.

What is the CAS number of Diphenyl[4-(trifluoromethyl)phenyl]phosphine?

The CAS number is 13406-28-5.

Please kindly note that our products and services are for research use only.