Dimethylphosphorodithioate

Catalog Number	ACM756809-1
CAS	756-80-9
Structure
Synonyms	O,O-Dimethyl dithiophosphate; Dimethyldithiophosphate
IUPAC Name	dimethoxy-sulfanyl-sulfanylidene-lambda5-phosphane
Molecular Weight	158.18
Molecular Formula	C2H7O2PS2
Canonical SMILES	COP(=S)(OC)S
InChI	CZGGKXNYNPJFAX-UHFFFAOYSA-N
InChI Key	InChI=1S/C2H7O2PS2/c1-3-5(6,7)4-2/h1-2H3,(H,6,7)
Boiling Point	65 °C
Purity	85%+
Density	1.29 g/cm3
Appearance	Liquid
EC Number	212-053-9
Isomeric SMILES	COP(=S)(OC)S
pKa	-0.10±0.30(Predicted)

Q&A

How many covalently-bonded units are present in dimethylphosphorodithioate?

There is 1 covalently-bonded unit present in dimethylphosphorodithioate.

How many hydrogen bond acceptors are present in dimethylphosphorodithioate?

There are 8 hydrogen bond acceptors in dimethylphosphorodithioate.

What is the Canonical SMILES notation for dimethylphosphorodithioate?

The Canonical SMILES notation for dimethylphosphorodithioate is CCOC(=O)CC(C(=O)OCC)SP(=S)(OC)OC.

How many heavy atoms are present in dimethylphosphorodithioate?

There are 19 heavy atoms present in dimethylphosphorodithioate.

What is the CAS number of dimethylphosphorodithioate?

The CAS number of dimethylphosphorodithioate is 121-75-5.

How many rotatable bonds are present in dimethylphosphorodithioate?

There are 11 rotatable bonds present in dimethylphosphorodithioate.

What are some common synonyms for dimethylphosphorodithioate?

Some common synonyms for dimethylphosphorodithioate include malathion, Carbophos, and Mercaptothion.

Does dimethylphosphorodithioate have any defined atom stereocenter count?

No, dimethylphosphorodithioate does not have any defined atom stereocenter count.

What is the topological polar surface area of dimethylphosphorodithioate?

The topological polar surface area of dimethylphosphorodithioate is 128.