2,9-Dimethyl-1,10-phenanthroline

Catalog Number	ACM484117-2
CAS	484-11-7
Structure
Synonyms	Neocuproine
IUPAC Name	2,9-dimethyl-1,10-phenanthroline
Molecular Weight	208.26
Molecular Formula	C14H12N2
InChI	IYRGXJIJGHOCFS-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H12N2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9/h3-8H,1-2H3
Boiling Point	367.4 °C at 760 mmHg
Melting Point	159 °C
Purity	98%
Appearance	Beige crystalline
Isomeric SMILES	CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C

Q&A

What is the chemical formula of Neocuproine?

The chemical formula of Neocuproine is C14H12N2.

What is the melting point of Neocuproine?

The melting point of Neocuproine is 159-164 °C.

What is the color of Neocuproine?

Neocuproine is white to beige in color.

What is the solubility of Neocuproine in methanol?

Neocuproine is soluble in methanol at 0.1 g/mL.

What is the Refractive Index of Neocuproine?

The estimated refractive index of Neocuproine is 1.6152.

What is the Hazard Code associated with Neocuproine?

The Hazard Codes for Neocuproine are Xi and Xn.

What are the Safety Statements related to Neocuproine?

The Safety Statements for Neocuproine are 26-36/37/39-36-24/25.

What is the main use of Neocuproine?

Neocuproine is a phenanthroline-based metal ion chelating agent.

How can Neocuproine be purified?

Neocuproine can be purified as the hemihydrate by crystallization from water and as the anhydrous base from benzene.

How is the selectivity of Neocuproine described in comparison to other reagents?

Neocuproine is considered one of the most selective reagents due to its steric hindrance and functional grouping characteristic.