Dimethoxyphenylphosphine

Catalog Number	ACM2946614-1
CAS	2946-61-4
Structure
Synonyms	Dimethyl phenylphosphonite; Phenylphosphonous Acid Dimethyl Ester
IUPAC Name	dimethoxy(phenyl)phosphane
Molecular Weight	170.15
Molecular Formula	C8H11O2P
InChI	LMZLQYYLELWCCW-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3
Boiling Point	77-79 °C at 7 mmHg
Flash Point	>230 °F
Purity	98%
Density	1.072 g/mL at 25 °C(lit.)
Appearance	Liquid
Isomeric SMILES	COP(C1=CC=CC=C1)OC

Q&A

What is the InChIKey of Dimethoxyphenylphosphine?

The InChIKey of Dimethoxyphenylphosphine is OXDOANYFRLHSML-UHFFFAOYSA-N.

What is the CAS number of Dimethoxyphenylphosphine?

The CAS number of Dimethoxyphenylphosphine is 2240-41-7.

What is the Canonical SMILES notation for Dimethoxyphenylphosphine?

The Canonical SMILES notation for Dimethoxyphenylphosphine is COP(=O)(C1=CC=CC=C1)OC.

How many heavy atoms are present in Dimethoxyphenylphosphine?

There are 12 heavy atoms present in Dimethoxyphenylphosphine.

What is the molecular formula of Dimethoxyphenylphosphine?

The molecular formula of Dimethoxyphenylphosphine is C8H11O3P.

How many hydrogen bond acceptor counts does Dimethoxyphenylphosphine have?

Dimethoxyphenylphosphine has 3 hydrogen bond acceptor counts.

What is the IUPAC name of Dimethoxyphenylphosphine?

The IUPAC name of Dimethoxyphenylphosphine is dimethoxyphosphorylbenzene.

What is the XLogP3 value of Dimethoxyphenylphosphine?

The XLogP3 value of Dimethoxyphenylphosphine is 0.9.

What is the Computed Properties Rotatable Bond Count of Dimethoxyphenylphosphine?

The Computed Properties Rotatable Bond Count of Dimethoxyphenylphosphine is 3.