ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Diisopropyl(phenyl)phosphine

Catalog Number ACM6372436-1
CAS 6372-43-6
Structure {[CurrentData.Name]}
Synonyms Phenyl-Di(Propan-2-Yl)Phosphane
IUPAC Name phenyl-di(propan-2-yl)phosphane
Molecular Weight 194.25
Molecular Formula C12H19P
InChI AIFSJAIZLCBORN-UHFFFAOYSA-N
InChI Key InChI=1S/C12H19P/c1-10(2)13(11(3)4)12-8-6-5-7-9-12/h5-11H,1-4H3
Purity 98%
Isomeric SMILES CC(C)P(C1=CC=CC=C1)C(C)C
Q&A

What is the CAS number for Diisopropyl(phenyl)phosphine?

The CAS number for Diisopropyl(phenyl)phosphine is 6372-43-6.

What is the molecular formula of Diisopropyl(phenyl)phosphine?

The molecular formula of Diisopropyl(phenyl)phosphine is C12H19P.

What is the molecular weight of Diisopropyl(phenyl)phosphine?

The molecular weight of Diisopropyl(phenyl)phosphine is 194.25g/mol.

What is the exact mass of Diisopropyl(phenyl)phosphine?

The exact mass of Diisopropyl(phenyl)phosphine is 194.122437604.

How many heavy atoms are present in the molecule of Diisopropyl(phenyl)phosphine?

There are 13 heavy atoms present in the molecule of Diisopropyl(phenyl)phosphine.

What is the Canonical SMILES representation of Diisopropyl(phenyl)phosphine?

The Canonical SMILES representation of Diisopropyl(phenyl)phosphine is CC(C)P(C1=CC=CC=C1)C(C)C.

How many rotatable bonds are present in the molecule of Diisopropyl(phenyl)phosphine?

There are 3 rotatable bonds present in the molecule of Diisopropyl(phenyl)phosphine.

What is the InChIKey for Diisopropyl(phenyl)phosphine?

The InChIKey for Diisopropyl(phenyl)phosphine is AIFSJAIZLCBORN-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does Diisopropyl(phenyl)phosphine have?

Diisopropyl(phenyl)phosphine has 0 hydrogen bond acceptor counts.

What are some other names or synonyms for Diisopropyl(phenyl)phosphine?

Some other names or synonyms for Diisopropyl(phenyl)phosphine include phosphine, bis(1-methylethyl)phenyl-, phenyl-di(propan-2-yl)phosphane, and NSC244301.

Please kindly note that our products and services are for research use only.