What is the CAS number for Diisopropyl(phenyl)phosphine?
The CAS number for Diisopropyl(phenyl)phosphine is 6372-43-6.
What is the molecular formula of Diisopropyl(phenyl)phosphine?
The molecular formula of Diisopropyl(phenyl)phosphine is C12H19P.
What is the molecular weight of Diisopropyl(phenyl)phosphine?
The molecular weight of Diisopropyl(phenyl)phosphine is 194.25g/mol.
What is the exact mass of Diisopropyl(phenyl)phosphine?
The exact mass of Diisopropyl(phenyl)phosphine is 194.122437604.
How many heavy atoms are present in the molecule of Diisopropyl(phenyl)phosphine?
There are 13 heavy atoms present in the molecule of Diisopropyl(phenyl)phosphine.
What is the Canonical SMILES representation of Diisopropyl(phenyl)phosphine?
The Canonical SMILES representation of Diisopropyl(phenyl)phosphine is CC(C)P(C1=CC=CC=C1)C(C)C.
How many rotatable bonds are present in the molecule of Diisopropyl(phenyl)phosphine?
There are 3 rotatable bonds present in the molecule of Diisopropyl(phenyl)phosphine.
What is the InChIKey for Diisopropyl(phenyl)phosphine?
The InChIKey for Diisopropyl(phenyl)phosphine is AIFSJAIZLCBORN-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does Diisopropyl(phenyl)phosphine have?
Diisopropyl(phenyl)phosphine has 0 hydrogen bond acceptor counts.
What are some other names or synonyms for Diisopropyl(phenyl)phosphine?
Some other names or synonyms for Diisopropyl(phenyl)phosphine include phosphine, bis(1-methylethyl)phenyl-, phenyl-di(propan-2-yl)phosphane, and NSC244301.
