What is the molecular formula of diethyl 2,5-dibromoterephthalate?
The molecular formula is C12H12Br2O4.
What are some synonyms for diethyl 2,5-dibromoterephthalate?
Some synonyms include Diethyl 2,5-Dibromoterephthalate, 2,5-Dibromoterephthalic Acid Diethyl Ester, and Diethyl 2,5-dibromobenzene-1,4-dicarboxylate.
What is the molecular weight of diethyl 2,5-dibromoterephthalate?
The molecular weight is 380.03 g/mol.
When was diethyl 2,5-dibromoterephthalate created and modified in PubChem?
It was created on 2007-12-05 and last modified on 2023-12-02.
What is the IUPAC name of diethyl 2,5-dibromoterephthalate?
The IUPAC name is diethyl 2,5-dibromobenzene-1,4-dicarboxylate.
What is the InChI of diethyl 2,5-dibromoterephthalate?
The InChI is InChI=1S/C12H12Br2O4/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6H,3-4H2,1-2H3.
What is the InChIKey of diethyl 2,5-dibromoterephthalate?
The InChIKey is WXRSDHICEYICMV-UHFFFAOYSA-N.
What is the canonical SMILES of diethyl 2,5-dibromoterephthalate?
The canonical SMILES is CCOC(=O)C1=CC(=C(C=C1Br)C(=O)OCC)Br.
What is the CAS number of diethyl 2,5-dibromoterephthalate?
The CAS number is 18013-97-3.
What is the XLogP3-AA value of diethyl 2,5-dibromoterephthalate?
The XLogP3-AA value is 3.7.
