Diethyl 2,5-Dihydroxyterephthalate

Catalog Number	ACM5870382-2
CAS	5870-38-2
Structure
Synonyms	2,5-Dihydroxyterephthalic Acid Diethyl Ester; Diethyl 2,5-Dihydroxybenzene-1,4-Dicarboxylate
Molecular Weight	254.24
Molecular Formula	C12H14O6
Canonical SMILES	CCOC(=O)c1cc(O)c(cc1O)C(=O)OCC
InChI	1S/C12H14O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6,13-14H,3-4H2,1-2H3
InChI Key	UQOUOXLHXPHDHF-UHFFFAOYSA-N
Boiling Point	408.5 °C at 760 mmHg
Melting Point	135-137 °C (lit.)
Purity	98%
Appearance	Earthy yellow powder
Application	This product is suitable for scientific research.
EC Number	227-522-3
MDL Number	MFCD00055430
PubChem ID	24863868

Q&A

What is the molecular formula of diethyl 2,5-dihydroxyterephthalate?

The molecular formula is C12H14O6.

When was diethyl 2,5-dihydroxyterephthalate created?

It was created on March 26, 2005.

What is the IUPAC name of diethyl 2,5-dihydroxyterephthalate?

The IUPAC name is diethyl 2,5-dihydroxybenzene-1,4-dicarboxylate.

What is the InChI of diethyl 2,5-dihydroxyterephthalate?

The InChI is InChI=1S/C12H14O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6,13-14H,3-4H2,1-2H3.

What is the InChIKey of diethyl 2,5-dihydroxyterephthalate?

The InChIKey is UQOUOXLHXPHDHF-UHFFFAOYSA-N.

What is the CAS number of diethyl 2,5-dihydroxyterephthalate?

The CAS number is 5870-38-2.

What is the molecular weight of diethyl 2,5-dihydroxyterephthalate?

The molecular weight is 254.24 g/mol.

How many hydrogen bond donor counts does diethyl 2,5-dihydroxyterephthalate have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does diethyl 2,5-dihydroxyterephthalate have?

It has 6 hydrogen bond acceptor counts.

How many rotatable bond counts does diethyl 2,5-dihydroxyterephthalate have?

It has 6 rotatable bond counts.