Dicyclohexylphosphine

Catalog Number	ACM829845
CAS	829-84-5
Structure
Synonyms	Dicyclohexylphosphane
IUPAC Name	dicyclohexylphosphane
Molecular Weight	198.28
Molecular Formula	C12H23P
InChI	HDULBKVLSJEMGN-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H23P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2
Boiling Point	129 °C at 8 mmHg
Melting Point	2 °C
Flash Point	2 °C
Purity	98%
Density	0.98 g/cm3
Appearance	Liquid
Isomeric SMILES	C1CCC(CC1)PC2CCCCC2

Q&A

What is the CAS number for Dicyclohexylphosphine?

The CAS number for Dicyclohexylphosphine is 829-84-5.

What is the molecular formula of Dicyclohexylphosphine?

The molecular formula of Dicyclohexylphosphine is C12H23P.

What is the molecular weight of Dicyclohexylphosphine?

The molecular weight of Dicyclohexylphosphine is 198.28g/mol.

What is the Canonical SMILES representation of Dicyclohexylphosphine?

The Canonical SMILES representation of Dicyclohexylphosphine is C1CCC(CC1)PC2CCCCC2.

How many heavy atoms are present in Dicyclohexylphosphine?

There are 13 heavy atoms present in Dicyclohexylphosphine.

What is the InChIKey for Dicyclohexylphosphine?

The InChIKey for Dicyclohexylphosphine is HDULBKVLSJEMGN-UHFFFAOYSA-N.

What is the IUPAC name of Dicyclohexylphosphine?

The IUPAC name of Dicyclohexylphosphine is dicyclohexylphosphane.

What is the exact mass of Dicyclohexylphosphine?

The exact mass of Dicyclohexylphosphine is 198.153737731.

How many rotatable bonds are there in Dicyclohexylphosphine?

There are 2 rotatable bonds in Dicyclohexylphosphine.

What is the European Community (EC) Number for Dicyclohexylphosphine?

The European Community (EC) Number for Dicyclohexylphosphine is 212-590-9.