Dicyclohexylethylphosphine tetrafluoroborate

Catalog Number	ACM1215113737
CAS	1215113-73-7
IUPAC Name	dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate
Molecular Weight	314.15
Molecular Formula	C14H28BF4P
InChI	FUAOOPLFSZKCMD-UHFFFAOYSA-O
InChI Key	InChI=1S/C14H27P.BF4/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;2-1(3,4)5/h13-14H,2-12H2,1H3;/q;-1/p+1
Purity	98%
Isomeric SMILES	[H+].[B-](F)(F)(F)F.CCP(C1CCCCC1)C2CCCCC2

Q&A

What is the exact mass of Dicyclohexylethylphosphine tetrafluoroborate?

The exact mass is 314.1957807.

What is the molecular formula of Dicyclohexylethylphosphine tetrafluoroborate?

The molecular formula is C14H28BF4P.

How many heavy atoms are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 20 heavy atoms.

What is the IUPAC name of Dicyclohexylethylphosphine tetrafluoroborate?

The IUPAC name is dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate.

What is the molecular weight of Dicyclohexylethylphosphine tetrafluoroborate?

The molecular weight is 314.15g/mol.

How many hydrogen bond acceptors are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 5 hydrogen bond acceptors.

What is the Canonical SMILES of Dicyclohexylethylphosphine tetrafluoroborate?

[H+].[B-](F)(F)(F)F.CCP(C1CCCCC1)C2CCCCC2

What is the InChIKey of Dicyclohexylethylphosphine tetrafluoroborate?

The InChIKey is FUAOOPLFSZKCMD-UHFFFAOYSA-O.

How many rotatable bonds are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 3 rotatable bonds.

What are the depositor-supplied synonyms for Dicyclohexylethylphosphine tetrafluoroborate?

The depositor-supplied synonym is Dicyclohexylethylphosphine tetrafluoroborate.