ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Dicyclohexylethylphosphine tetrafluoroborate

Catalog Number ACM1215113737
CAS 1215113-73-7
IUPAC Name dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate
Molecular Weight 314.15
Molecular Formula C14H28BF4P
InChI FUAOOPLFSZKCMD-UHFFFAOYSA-O
InChI Key InChI=1S/C14H27P.BF4/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;2-1(3,4)5/h13-14H,2-12H2,1H3;/q;-1/p+1
Purity 98%
Isomeric SMILES [H+].[B-](F)(F)(F)F.CCP(C1CCCCC1)C2CCCCC2
Q&A

What is the exact mass of Dicyclohexylethylphosphine tetrafluoroborate?

The exact mass is 314.1957807.

What is the molecular formula of Dicyclohexylethylphosphine tetrafluoroborate?

The molecular formula is C14H28BF4P.

How many heavy atoms are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 20 heavy atoms.

What is the IUPAC name of Dicyclohexylethylphosphine tetrafluoroborate?

The IUPAC name is dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate.

What is the molecular weight of Dicyclohexylethylphosphine tetrafluoroborate?

The molecular weight is 314.15g/mol.

How many hydrogen bond acceptors are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 5 hydrogen bond acceptors.

What is the Canonical SMILES of Dicyclohexylethylphosphine tetrafluoroborate?

[H+].[B-](F)(F)(F)F.CCP(C1CCCCC1)C2CCCCC2

What is the InChIKey of Dicyclohexylethylphosphine tetrafluoroborate?

The InChIKey is FUAOOPLFSZKCMD-UHFFFAOYSA-O.

How many rotatable bonds are present in Dicyclohexylethylphosphine tetrafluoroborate?

There are 3 rotatable bonds.

What are the depositor-supplied synonyms for Dicyclohexylethylphosphine tetrafluoroborate?

The depositor-supplied synonym is Dicyclohexylethylphosphine tetrafluoroborate.

Please kindly note that our products and services are for research use only.