ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Dicyclohexylchlorophosphine

Catalog Number ACM16523549-1
CAS 16523-54-9
Structure {[CurrentData.Name]}
Synonyms Cy2PCl; Dicyclohexylphosphine chloride; Chlorodicyclohexylphosphine
IUPAC Name chloro(dicyclohexyl)phosphane
Molecular Weight 232.73
Molecular Formula C12H22ClP
InChI AKJFBIZAEPTXIL-UHFFFAOYSA-N
InChI Key InChI=1S/C12H22ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2
Boiling Point 165 °C at 12 mmHg(lit.)
Melting Point 126-128 °C
Flash Point >230 °F
Purity 97%
Density 1.054 g/mL at 25 °C(lit.)
Appearance Liquid
Isomeric SMILES C1CCC(CC1)P(C2CCCCC2)Cl
Q&A

What is the CAS number for Dicyclohexylchlorophosphine?

The CAS number for Dicyclohexylchlorophosphine is 16523-54-9.

What is the molecular weight of Dicyclohexylchlorophosphine?

The molecular weight of Dicyclohexylchlorophosphine is 232.73 g/mol.

What is the IUPAC name of Dicyclohexylchlorophosphine?

The IUPAC name of Dicyclohexylchlorophosphine is chloro(dicyclohexyl)phosphane.

How many heavy atoms are present in the chemical structure of Dicyclohexylchlorophosphine?

There are 14 heavy atoms present in the chemical structure of Dicyclohexylchlorophosphine.

What is the Topological Polar Surface Area of Dicyclohexylchlorophosphine?

The Topological Polar Surface Area of Dicyclohexylchlorophosphine is 0.

What is the Canonical SMILES notation for Dicyclohexylchlorophosphine?

The Canonical SMILES notation for Dicyclohexylchlorophosphine is C1CCC(CC1)P(C2CCCCC2)Cl.

What is the XLogP3 value of Dicyclohexylchlorophosphine?

The XLogP3 value of Dicyclohexylchlorophosphine is 4.3.

What is the exact mass of Dicyclohexylchlorophosphine?

The exact mass of Dicyclohexylchlorophosphine is 232.1147654.

How many rotatable bonds are present in Dicyclohexylchlorophosphine?

There are 2 rotatable bonds present in Dicyclohexylchlorophosphine.

What is the InChIKey code of Dicyclohexylchlorophosphine?

The InChIKey code of Dicyclohexylchlorophosphine is AKJFBIZAEPTXIL-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.