Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)

Catalog Number	ACM506417410-1
CAS	506417-41-0
Structure
Synonyms	Dichlororuthenium;2-diphenylphosphanylethanamine
IUPAC Name	dichlororuthenium;2-diphenylphosphanylethanamine;
Molecular Weight	630.5
Molecular Formula	C28H32Cl2N2P2Ru
Canonical SMILES	C1=CC=C(C=C1)P(CCN)C2=CC=CC=C2.C1=CC=C(C=C1)P(CCN)C2=CC=CC=C2.Cl[Ru]Cl
InChI	InChI=1S/2C14H16NP.2ClH.Ru/c2*15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h2*1-10H,11-12,15H2;2*1H;/q;+2/p-2
InChI Key	BJNVYFXBTNBKRU-UHFFFAOYSA-L
Melting Point	130-135 °C
Purity	95%
Appearance	Powder
Application	Efficient catalyst for the dihydrogen reduction of carboxylic esters and amides to alcohols.
Complexity	168
Covalently-Bonded Unit Count	3
Exact Mass	630.046119
Heavy Atom Count	35
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	630.046119
Rotatable Bond Count	8
Topological Polar Surface Area	52 Ų

Q&A

What is the molecular formula of Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

The molecular formula is C28H32Cl2N2P2Ru.

What is the molecular weight of Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

The molecular weight is 630.5 g/mol.

What are the synonyms for Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

Some synonyms include Dichlorobis[2-(diphenylphosphino)ethylamine]ruthenium(II) and dichlororuthenium;2-diphenylphosphanylethanamine.

When was Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II) created and modified in PubChem?

It was created on 2007-07-16 and last modified on 2023-12-30.

What is the InChIKey for Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

The InChIKey is BJNVYFXBTNBKRU-UHFFFAOYSA-L.

What is the canonical SMILES representation of Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

The canonical SMILES is C1=CC=C(C=C1)P(CCN)C2=CC=CC=C2.C1=CC=C(C=C1)P(CCN)C2=CC=CC=C2.Cl[Ru]Cl.

What is the CAS number for Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

The CAS number is 506417-41-0.

How many hydrogen bond donor counts does Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II) have?

It has 2 hydrogen bond donor counts.

What is the rotatable bond count for Dichlorobis(2-(diphenylphosphino)ethylamine)ruthenium(II)?

It has 8 rotatable bond counts.

Is the compound canonicalized according to PubChem?

Yes, the compound is canonicalized in PubChem.