Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)

Catalog Number	ACM106245436-1
CAS	106245-43-6
Synonyms	Dichloroiron;3-diphenylphosphaniumylpropyl(diphenyl)phosphanium
Molecular Weight	541.2
Molecular Formula	C27H28Cl2FeP2
Canonical SMILES	C1=CC=C(C=C1)[PH+](CCC[PH+](C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Fe]Cl
InChI	InChI=1S/C27H26P2.2ClH.Fe/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;/h1-12,14-21H,13,22-23H2;2*1H;/q;+2
InChI Key	PUWOIOPXQBCXTD-UHFFFAOYSA-N
Purity	98%
Appearance	White powder
Complexity	381
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	540.039266
Heavy Atom Count	32
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	540.039266
Rotatable Bond Count	4
Topological Polar Surface Area	0 Ų

Q&A

What is the CAS number of Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

The CAS number is 106245-43-6.

What is the molecular weight of Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

The molecular weight is 539.193862.

What is the form of Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

It is in powder form.

How does Dichloro[1,3-bis(diphenylphosphino)propane]iron(II) react in cross-coupling reactions?

It is used as an iron precatalyst in the cross-coupling of benzylhalides and phosphates.

What color is Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

It is white in color.

What are some synonyms for Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

Some synonyms include DICHLORO[1,3-BIS(DIPHENYLPHOSPHINO)PROPANE]IRON(II), 98% and Dichloro[1,3-bis(diphenylphosphino)propane]iron(II), 98%.

How is Dichloro[1,3-bis(diphenylphosphino)propane]iron(II) sensitive?

It is air sensitive.

What are some reactions in which Dichloro[1,3-bis(diphenylphosphino)propane]iron(II) is involved?

It is involved in the expedient iron-catalyzed coupling of alkyl, benzyl, and allyl halides with arylboronic esters.

What is the molecular formula of Dichloro[1,3-bis(diphenylphosphino)propane]iron(II)?

The molecular formula is C27H26Cl2FeP2.

What is the main use of Dichloro[1,3-bis(diphenylphosphino)propane]iron(II) in reactions?

It is used as an iron precatalyst in various cross-coupling reactions.