Dibutyltin diacetate

Catalog Number	ACM1067330-2
CAS	1067-33-0
Structure
Synonyms	Diacetoxybutyltin
Molecular Weight	351.03
Molecular Formula	C12H24O4Sn
Canonical SMILES	CCCC[Sn](CCCC)(OC(=O)C)OC(=O)C
InChI	InChI=1S/2C4H9.2C2H4O2.Sn/c2*1-3-4-2;2*1-2(3)4;/h2*1,3-4H2,2H3;2*1H3,(H,3,4);/q;+2/p-2
InChI Key	JJLKTTCRRLHVGL-UHFFFAOYSA-L
Boiling Point	139 °C(5 mmHg)
Melting Point	7-10 °C
Flash Point	143 °C
Purity	98%
Density	1.31 g/mL
Appearance	Liquid
Storage	Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not store in metal containers. Store protected from moisture. Store protected from light.
EC Number	213-928-8
Exact Mass	352.069662
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	352.069662
Rotatable Bond Count	10
Topological Polar Surface Area	52.6 Ų

Q&A

What is the molecular formula of Dibutyltin diacetate?

The molecular formula of Dibutyltin diacetate is C12H24O4Sn.

What is the molecular weight of Dibutyltin diacetate?

The molecular weight of Dibutyltin diacetate is 351.03 g/mol.

What are some synonyms for Dibutyltin diacetate?

Some synonyms for Dibutyltin diacetate are DIBUTYLTIN DIACETATE, Stannane, bis(acetyloxy)dibutyl-, and Diacetoxybutyltin.

What is the IUPAC name of Dibutyltin diacetate?

The IUPAC name of Dibutyltin diacetate is [acetyloxy(dibutyl)stannyl] acetate.

What is the InChIKey of Dibutyltin diacetate?

The InChIKey of Dibutyltin diacetate is JJLKTTCRRLHVGL-UHFFFAOYSA-L.

What is the CAS number for Dibutyltin diacetate?

The CAS number for Dibutyltin diacetate is 1067-33-0.

How many hydrogen bond acceptors does Dibutyltin diacetate have?

Dibutyltin diacetate has 4 hydrogen bond acceptors.

What is the exact mass of Dibutyltin diacetate?

The exact mass of Dibutyltin diacetate is 352.069662 g/mol.

How many rotatable bond counts does Dibutyltin diacetate have?

Dibutyltin diacetate has 10 rotatable bond counts.

What is the topological polar surface area of Dibutyltin diacetate?

The topological polar surface area of Dibutyltin diacetate is 52.6 Å2.