Dibromotriphenylphosphorane

Catalog Number	ACM1034395-1
CAS	1034-39-5
Structure
Synonyms	Triphenylphosphine dibromide; Bromotriphenylphosphonium bromide
IUPAC Name	dibromo(triphenyl)-lambda5-phosphane
Molecular Weight	422.09
Molecular Formula	C18H15Br2P
InChI	OCXGTPDKNBIOTF-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H15Br2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Melting Point	235 °C(dec.)(lit.)
Purity	97%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)(C3=CC=CC=C3)(Br)Br

Q&A

What is the CAS number for dibromotriphenylphosphorane?

The CAS number for dibromotriphenylphosphorane is 1034-39-5.

What is the Canonical SMILES for dibromotriphenylphosphorane?

The Canonical SMILES for dibromotriphenylphosphorane is C1=CC=C(C=C1)P(C2=CC=CC=C2)(C3=CC=CC=C3)(Br)Br.

How many heavy atoms are present in the molecule of dibromotriphenylphosphorane?

There are 21 heavy atoms present in the molecule of dibromotriphenylphosphorane.

What is the XLogP3 value for dibromotriphenylphosphorane?

The XLogP3 value for dibromotriphenylphosphorane is 6.5.

What are some alternative names for dibromotriphenylphosphorane?

Some alternative names for dibromotriphenylphosphorane are Triphenylphosphine dibromide, Triphenyldibromophosphorane, and Phosphorane, dibromotriphenyl.

What is the molecular weight of dibromotriphenylphosphorane?

The molecular weight of dibromotriphenylphosphorane is 422.1 g/mol.

Does dibromotriphenylphosphorane have any hydrogen bond acceptor count?

No, dibromotriphenylphosphorane does not have any hydrogen bond acceptor count.

What is the InChIKey for dibromotriphenylphosphorane?

The InChIKey for dibromotriphenylphosphorane is OCXGTPDKNBIOTF-UHFFFAOYSA-N.

How many rotatable bond count does dibromotriphenylphosphorane have?

Dibromotriphenylphosphorane has 3 rotatable bond counts.