ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Dibromotriphenylphosphorane

Catalog Number ACM1034395-1
CAS 1034-39-5
Structure {[CurrentData.Name]}
Synonyms Triphenylphosphine dibromide; Bromotriphenylphosphonium bromide
IUPAC Name dibromo(triphenyl)-lambda5-phosphane
Molecular Weight 422.09
Molecular Formula C18H15Br2P
InChI OCXGTPDKNBIOTF-UHFFFAOYSA-N
InChI Key InChI=1S/C18H15Br2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Melting Point 235 °C(dec.)(lit.)
Purity 97%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)(C3=CC=CC=C3)(Br)Br
Q&A

What is the CAS number for dibromotriphenylphosphorane?

The CAS number for dibromotriphenylphosphorane is 1034-39-5.

What is the Canonical SMILES for dibromotriphenylphosphorane?

The Canonical SMILES for dibromotriphenylphosphorane is C1=CC=C(C=C1)P(C2=CC=CC=C2)(C3=CC=CC=C3)(Br)Br.

How many heavy atoms are present in the molecule of dibromotriphenylphosphorane?

There are 21 heavy atoms present in the molecule of dibromotriphenylphosphorane.

What is the XLogP3 value for dibromotriphenylphosphorane?

The XLogP3 value for dibromotriphenylphosphorane is 6.5.

What are some alternative names for dibromotriphenylphosphorane?

Some alternative names for dibromotriphenylphosphorane are Triphenylphosphine dibromide, Triphenyldibromophosphorane, and Phosphorane, dibromotriphenyl.

What is the molecular weight of dibromotriphenylphosphorane?

The molecular weight of dibromotriphenylphosphorane is 422.1 g/mol.

Does dibromotriphenylphosphorane have any hydrogen bond acceptor count?

No, dibromotriphenylphosphorane does not have any hydrogen bond acceptor count.

What is the InChIKey for dibromotriphenylphosphorane?

The InChIKey for dibromotriphenylphosphorane is OCXGTPDKNBIOTF-UHFFFAOYSA-N.

How many rotatable bond count does dibromotriphenylphosphorane have?

Dibromotriphenylphosphorane has 3 rotatable bond counts.

Please kindly note that our products and services are for research use only.