What is the molecular formula of dibenzo-24-crown-8?
The molecular formula of dibenzo-24-crown-8 is C24H32O8.
What is the molecular weight of dibenzo-24-crown-8?
The molecular weight of dibenzo-24-crown-8 is 448.5 g/mol.
What is the IUPAC name of dibenzo-24-crown-8?
The IUPAC name of dibenzo-24-crown-8 is 2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.0 12,17 ]dotriaconta-1(32),12,14,16,28,30-hexaene.
What is the InChI of dibenzo-24-crown-8?
The InChI of dibenzo-24-crown-8 is InChI=1S/C24H32O8/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22/h1-8H,9-20H2.
What is the InChIKey of dibenzo-24-crown-8?
The InChIKey of dibenzo-24-crown-8 is UNTITLLXXOKDTB-UHFFFAOYSA-N.
What is the canonical SMILES of dibenzo-24-crown-8?
The canonical SMILES of dibenzo-24-crown-8 is C1COCCOC2=CC=CC=C2OCCOCCOCCOC3=CC=CC=C3OCCO1.
What is the CAS number of dibenzo-24-crown-8?
The CAS number of dibenzo-24-crown-8 is 14174-09-5.
What is the European Community (EC) number of dibenzo-24-crown-8?
The European Community (EC) number of dibenzo-24-crown-8 is 238-027-7.
What is the ChEMBL ID of dibenzo-24-crown-8?
The ChEMBL ID of dibenzo-24-crown-8 is CHEMBL154420.
What is the formal charge of dibenzo-24-crown-8?
The formal charge of dibenzo-24-crown-8 is 0.