ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Di-t-butylneopentylphosphine

Catalog Number ACM60633218
CAS 60633-21-8
Structure {[CurrentData.Name]}
Synonyms Bis(1,1-Dimethylethyl)(2,2-Dimethylpropyl)Phosphine
IUPAC Name ditert-butyl(2,2-dimethylpropyl)phosphane
Molecular Weight 216.34
Molecular Formula C13H29P
InChI JBGICSFDKZAWFJ-UHFFFAOYSA-N
InChI Key InChI=1S/C13H29P/c1-11(2,3)10-14(12(4,5)6)13(7,8)9/h10H2,1-9H3
Boiling Point 40 °C at 0.1 mmHg
Purity 98%
Density 0.839 g/mL at 25 °C
Isomeric SMILES CC(C)(C)CP(C(C)(C)C)C(C)(C)C
Q&A

What is the CAS number for Di-t-butylneopentylphosphine?

The CAS number for Di-t-butylneopentylphosphine is 60633-21-8.

What is the Canonical SMILES representation of Di-t-butylneopentylphosphine?

The Canonical SMILES representation of Di-t-butylneopentylphosphine is CC(C)(C)CP(C(C)(C)C)C(C)(C)C.

How many heavy atoms are present in the molecular structure of Di-t-butylneopentylphosphine?

There are 14 heavy atoms present in the molecular structure of Di-t-butylneopentylphosphine.

What is the exact molecular weight of Di-t-butylneopentylphosphine?

The exact molecular weight of Di-t-butylneopentylphosphine is 216.34 g/mol.

What is the InChIKey for Di-t-butylneopentylphosphine?

The InChIKey for Di-t-butylneopentylphosphine is JBGICSFDKZAWFJ-UHFFFAOYSA-N.

How many rotatable bonds are present in the structure of Di-t-butylneopentylphosphine?

There are 4 rotatable bonds present in the structure of Di-t-butylneopentylphosphine.

Does Di-t-butylneopentylphosphine have any hydrogen bond acceptor count or donor count?

No, Di-t-butylneopentylphosphine does not have any hydrogen bond acceptor count or donor count.

What is the monoisotopic mass of Di-t-butylneopentylphosphine?

The monoisotopic mass of Di-t-butylneopentylphosphine is 216.200687923.

What is the IUPAC name of Di-t-butylneopentylphosphine?

The IUPAC name of Di-t-butylneopentylphosphine is ditert-butyl(2,2-dimethylpropyl)phosphane.

Can you provide another name or synonym for Di-t-butylneopentylphosphine?

Another name or synonym for Di-t-butylneopentylphosphine is ditert-butyl(2,2-dimethylpropyl)phosphane.

Please kindly note that our products and services are for research use only.