Di(adamantan-1-yl)phosphine oxide

Catalog Number	ACM131266790-1
CAS	131266-79-0
Structure
Synonyms	Bis(1-Adamantyl)-Oxophosphanium; 1-(Adamantan-1-Ylphosphoryl)Adamantane
IUPAC Name	bis(1-adamantyl)-oxophosphanium
Molecular Weight	318.43
Molecular Formula	C20H31OP
InChI	YTLFFIFRPOHQPT-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H30OP/c21-22(19-7-13-1-14(8-19)3-15(2-13)9-19)20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2/q+1
Boiling Point	436.8±28.0 °C(Predicted)
Melting Point	255-258 °C
Purity	98%
Appearance	White powder
Isomeric SMILES	C1C2CC3CC1CC(C2)(C3)[P+](=O)C45CC6CC(C4)CC(C6)C5

Q&A

What is the InChIKey of Di(adamantan-1-yl)phosphine oxide?

The InChIKey of Di(adamantan-1-yl)phosphine oxide is YTLFFIFRPOHQPT-UHFFFAOYSA-N.

What is the CAS number of Di(adamantan-1-yl)phosphine oxide?

The CAS number of Di(adamantan-1-yl)phosphine oxide is 131266-79-0.

What is the Canonical SMILES of Di(adamantan-1-yl)phosphine oxide?

The Canonical SMILES of Di(adamantan-1-yl)phosphine oxide is C1C2CC3CC1CC(C2)(C3)[P+](=O)C45CC6CC(C4)CC(C6)C5.

How many heavy atoms are present in Di(adamantan-1-yl)phosphine oxide?

There are 22 heavy atoms present in Di(adamantan-1-yl)phosphine oxide.

What is the formal charge of Di(adamantan-1-yl)phosphine oxide?

The formal charge of Di(adamantan-1-yl)phosphine oxide is +1.

What is the IUPAC name of Di(adamantan-1-yl)phosphine oxide?

The IUPAC name of Di(adamantan-1-yl)phosphine oxide is bis(1-adamantyl)-oxophosphanium.

What is the molecular weight of Di(adamantan-1-yl)phosphine oxide?

The molecular weight of Di(adamantan-1-yl)phosphine oxide is 317.4 g/mol.

How many rotatable bonds are present in Di(adamantan-1-yl)phosphine oxide?

There are 2 rotatable bonds present in Di(adamantan-1-yl)phosphine oxide.

What is the Monoisotopic Mass of Di(adamantan-1-yl)phosphine oxide?

The Monoisotopic Mass of Di(adamantan-1-yl)phosphine oxide is 317.203427574.