Di-1-adamantylphosphinic chloride

Catalog Number	ACM126683996-1
CAS	126683-99-6
Structure
Synonyms	Bis(1-adamantyl)phosphinic chloride
IUPAC Name	1-[1-adamantyl(chloro)phosphoryl]adamantane
Molecular Weight	352.88
Molecular Formula	C20H30ClOP
InChI	RTFVOXURDFZPKR-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H30ClOP/c21-23(22,19-7-13-1-14(8-19)3-15(2-13)9-19)20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2
Boiling Point	498.0±12.0 °C(Predicted)
Melting Point	214 °C
Purity	98%
Density	1.23 g/cm3
Appearance	Solid
Isomeric SMILES	C1C2CC3CC1CC(C2)(C3)P(=O)(C45CC6CC(C4)CC(C6)C5)Cl

Q&A

What is the CAS number of DI-1-Adamantylphosphinic chloride?

The CAS number of DI-1-Adamantylphosphinic chloride is 126683-99-6.

What is the molecular weight of DI-1-Adamantylphosphinic chloride?

The molecular weight of DI-1-Adamantylphosphinic chloride is 352.9g/mol.

What is the Canonical SMILES of DI-1-Adamantylphosphinic chloride?

The Canonical SMILES of DI-1-Adamantylphosphinic chloride is C1C2CC3CC1CC(C2)(C3)P(=O)(C45CC6CC(C4)CC(C6)C5)Cl.

How many hydrogen bond acceptors are present in DI-1-Adamantylphosphinic chloride?

There is 1 hydrogen bond acceptor present in DI-1-Adamantylphosphinic chloride.

What is the InChIKey of DI-1-Adamantylphosphinic chloride?

The InChIKey of DI-1-Adamantylphosphinic chloride is RTFVOXURDFZPKR-UHFFFAOYSA-N.

What is the IUPAC Name of DI-1-Adamantylphosphinic chloride?

The IUPAC Name of DI-1-Adamantylphosphinic chloride is 1-[1-adamantyl(chloro)phosphoryl]adamantane.

How many covalently-bonded units are present in DI-1-Adamantylphosphinic chloride?

There is 1 covalently-bonded unit present in DI-1-Adamantylphosphinic chloride.

What is the topological polar surface area of DI-1-Adamantylphosphinic chloride?

The topological polar surface area of DI-1-Adamantylphosphinic chloride is 17.1.

How many rotatable bonds are present in DI-1-Adamantylphosphinic chloride?

There are 2 rotatable bonds present in DI-1-Adamantylphosphinic chloride.

What is the exact mass of DI-1-Adamantylphosphinic chloride?

The exact mass of DI-1-Adamantylphosphinic chloride is 352.1722803.