Di-1-adamantylchlorophosphine

Catalog Number	ACM157282194-1
CAS	157282-19-4
Structure
Synonyms	Bis(1-adamantyl)-chlorophosphane; Di(adamantan-1-yl)chlorophosphine
IUPAC Name	bis(1-adamantyl)-chlorophosphane
Molecular Weight	336.88
Molecular Formula	C20H30PCl
InChI	BVOJCPQWSXCCKU-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H30ClP/c21-22(19-7-13-1-14(8-19)3-15(2-13)9-19)20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2
Boiling Point	413.3±12.0 °C(Predicted)
Melting Point	168-173 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1C2CC3CC1CC(C2)(C3)P(C45CC6CC(C4)CC(C6)C5)Cl

Q&A

What is the CAS number of di-1-adamantylchlorophosphine?

The CAS number of di-1-adamantylchlorophosphine is 157282-19-4.

How many heavy atoms are present in the molecular formula of di-1-adamantylchlorophosphine?

There are 22 heavy atoms present in the molecular formula of di-1-adamantylchlorophosphine.

What is the molecular weight of di-1-adamantylchlorophosphine?

The molecular weight of di-1-adamantylchlorophosphine is 336.9g/mol.

What is the IUPAC name of di-1-adamantylchlorophosphine?

The IUPAC name of di-1-adamantylchlorophosphine is bis(1-adamantyl)-chlorophosphane.

Can di-1-adamantylchlorophosphine act as a hydrogen bond acceptor or donor?

No, di-1-adamantylchlorophosphine does not act as a hydrogen bond acceptor or donor.

What is the XLogP3 value of di-1-adamantylchlorophosphine?

The XLogP3 value of di-1-adamantylchlorophosphine is 6.1.

What is the exact mass of di-1-adamantylchlorophosphine?

The exact mass of di-1-adamantylchlorophosphine is 336.1773656.

How many rotatable bonds are present in the structure of di-1-adamantylchlorophosphine?

There are 2 rotatable bonds present in the structure of di-1-adamantylchlorophosphine.

What is the Canonical SMILES of di-1-adamantylchlorophosphine?

The Canonical SMILES of di-1-adamantylchlorophosphine is C1C2CC3CC1CC(C2)(C3)P(C45CC6CC(C4)CC(C6)C5)Cl.

What is the InChIKey of di-1-adamantylchlorophosphine?

The InChIKey of di-1-adamantylchlorophosphine is BVOJCPQWSXCCKU-UHFFFAOYSA-N.