What is the IUPAC name of Di(1-adamantyl)-1-piperidinylphenylphosphine?
The IUPAC name of Di(1-adamantyl)-1-piperidinylphenylphosphine is bis(1-adamantyl)-(2-piperidin-1-ylphenyl)phosphane.
What is the molecular formula of Di(1-adamantyl)-1-piperidinylphenylphosphine indicated by Di(1-adamantyl)-1-piperidinylphenylphosphine?
The molecular formula is C31H44NP.
What is the exact mass of Di(1-adamantyl)-1-piperidinylphenylphosphine?
The exact mass is 461.32113741 g/mol.
How many heavy atoms are present in Di(1-adamantyl)-1-piperidinylphenylphosphine?
There are 33 heavy atoms in Di(1-adamantyl)-1-piperidinylphenylphosphine.
How many rotatable bonds does Di(1-adamantyl)-1-piperidinylphenylphosphine have?
Di(1-adamantyl)-1-piperidinylphenylphosphine has 4 rotatable bonds.
Does Di(1-adamantyl)-1-piperidinylphenylphosphine have any defined atom stereocenters?
No, Di(1-adamantyl)-1-piperidinylphenylphosphine does not have any defined atom stereocenters.
What is the topological polar surface area of Di(1-adamantyl)-1-piperidinylphenylphosphine?
The topological polar surface area is 3.2.
What is the Canonical SMILES representation of Di(1-adamantyl)-1-piperidinylphenylphosphine?
The Canonical SMILES representation is C1CCN(CC1)C2=CC=CC=C2P(C34CC5CC(C3)CC(C5)C4)C67CC8CC(C6)CC(C8)C7.
How many conformers are available for this compound in the 3D-Conformer section?
There are multiple conformers available in the 3D-Conformer section.
What is the CAS number of Di(1-adamantyl)-1-piperidinylphenylphosphine?
The CAS number of Di(1-adamantyl)-1-piperidinylphenylphosphine is 1237588-13-4.