Copper(II) 2-ethylhexanoate

Catalog Number	ACM149111-3
CAS	149-11-1
Structure
Synonyms	Copper bis(2-ethylhexanoate)
IUPAC Name	copper;2-ethylhexanoate
Molecular Weight	349.95
Molecular Formula	C16H30CuO4
Canonical SMILES	CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Cu+2]
InChI	InChI=1S/2C8H16O2.Cu/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;+2/p-2
InChI Key	SEKCXMNFUDONGJ-UHFFFAOYSA-L
Melting Point	252 °C
Appearance	Powder
Application	Wood preservative, Anti-fungal
Complexity	93.9
Covalently-Bonded Unit Count	3
EC Number	244-846-0;205-731-0
Exact Mass	349.144007
Formal Charge	0
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	349.144007
Rotatable Bond Count	8
Topological Polar Surface Area	80.3 Ų

Q&A

What is the molecular formula of Copper(II) 2-ethylhexanoate?

The molecular formula is C16H30CuO4.

What is the molecular weight of Copper(II) 2-ethylhexanoate?

The molecular weight is 349.95 g/mol.

What are the synonyms of Copper(II) 2-ethylhexanoate?

The synonyms are Copper 2-ethylhexanoate, Cupric 2-ethylhexanoate, Copper bis(2-ethylhexanoate), and more.

What is the IUPAC name of Copper(II) 2-ethylhexanoate?

The IUPAC name is copper;2-ethylhexanoate.

What is the InChI of Copper(II) 2-ethylhexanoate?

The InChI is InChI=1S/2C8H16O2.Cu/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2.

What is the InChIKey of Copper(II) 2-ethylhexanoate?

The InChIKey is SEKCXMNFUDONGJ-UHFFFAOYSA-L.

What is the Canonical SMILES of Copper(II) 2-ethylhexanoate?

The Canonical SMILES is CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Cu+2].

What is the CAS number of Copper(II) 2-ethylhexanoate?

The CAS number is 149-11-1.

What is the European Community (EC) number of Copper(II) 2-ethylhexanoate?

The European Community (EC) number is 244-846-0.

What is the hydrogen bond acceptor count of Copper(II) 2-ethylhexanoate?

The hydrogen bond acceptor count is 4.