ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold

Catalog Number ACM915299240-1
CAS 915299-24-0
Structure Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold
Synonyms [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride
IUPAC Name chlorogold;tris(2,4-ditert-butylphenyl) phosphite;
Molecular Weight 879.3
Molecular Formula C42H63AuClO3P
Canonical SMILES CC(C)(C)C1=CC(=C(C=C1)OP(OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C)OC3=C(C=C(C=C3)C(C)(C)C)C(C)(C)C)C(C)(C)C.Cl[Au]
InChI InChI=1S/C42H63O3P.Au.ClH/c1-37(2,3)28-19-22-34(31(25-28)40(10,11)12)43-46(44-35-23-20-29(38(4,5)6)26-32(35)41(13,14)15)45-36-24-21-30(39(7,8)9)27-33(36)42(16,17)18;/h19-27H,1-18H3;1H/q;+1;/p-1
InChI Key GCWCLHMEYZKZRO-UHFFFAOYSA-M
Melting Point 200-202 °C
Purity 98%
Complexity 825
Covalently-Bonded Unit Count 2
Exact Mass 878.386906
Heavy Atom Count 48
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 878.386906
Rotatable Bond Count 12
Topological Polar Surface Area 27.7 Ų
Q&A

What is the molecular formula of Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The molecular formula is C42H63AuClO3P.

What is the molecular weight of Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The molecular weight is 879.3 g/mol.

What are some synonyms for Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

Some synonyms include chlorogold;tris(2,4-ditert-butylphenyl) phosphite and [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride.

When was Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold created?

It was created on January 1, 2008.

What are the component compounds of Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The component compounds are Tris(2,4-di-tert-butylphenyl) phosphite and gold(I) chloride.

What is the InChIKey of Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The InChIKey is GCWCLHMEYZKZRO-UHFFFAOYSA-M.

What is the CAS number for Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The CAS number is 915299-24-0.

How many hydrogen bond acceptors does Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold have?

It has 3 hydrogen bond acceptors.

What is the topological polar surface area of Chloro[tris(2,4-di-tert-butylphenyl)phosphite]gold?

The topological polar surface area is 27.7 Ų.

Is the compound Canonicalized?

Yes, the compound is Canonicalized.

Please kindly note that our products and services are for research use only.