Chloro{1,3-bis[2,6-bis(1-methylethyl)phenyl]-1,3-dihydro-4,5-dimethyl-2H-imidazol-2-ylidene}gold(I)

Catalog Number	ACM1192141664-1
CAS	1192141-66-4
Synonyms	[1,3-Bis[2,6-di(propan-2-yl)phenyl]-4,5-dimethylimidazol-2-ylidene]-chlorogold
Molecular Weight	649
Molecular Formula	C29H40AuClN2
Canonical SMILES	CC1=C(N(C(=[Au]Cl)N1C2=C(C=CC=C2C(C)C)C(C)C)C3=C(C=CC=C3C(C)C)C(C)C)C
InChI	InChI=1S/C29H40N2.Au.ClH/c1-18(2)24-13-11-14-25(19(3)4)28(24)30-17-31(23(10)22(30)9)29-26(20(5)6)15-12-16-27(29)21(7)8;/h11-16,18-21H,1-10H3;1H/q;+1;/p-1
InChI Key	UUKSMZKXKMHYHK-UHFFFAOYSA-M
Purity	98%
Appearance	White powder
Complexity	637
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	648.254572
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	648.254572
Rotatable Bond Count	6
Topological Polar Surface Area	6.5 Ų

Q&A

What is the CAS number of the compound?

The CAS number of the compound is 1192141-66-4.

What is the molecular weight of the compound?

The molecular weight of the compound is 650.06879.

What is the product name of the compound?

The product name of the compound is Chloro{1,3-bis[2,6-bis(1-methylethyl)phenyl]-1,3-dihydro-4,5-dimethyl-2H-imidazol-2-ylidene}gold(I).

What are some synonyms for the compound?

Synonyms for the compound include CHLORO{1,3-BIS[2,6-BIS(1-METHYLETHYL)PHENYL]-1,3-DIHYDRO-4,5-DIMETHYL-2H-IMIDAZOL-2-YLIDENE}GOLD(I), 98%IPRMEAUCL, and (1,3-Bis(2,6-diisopropylphenyl)-4,5-dimethyl-1,3-dihydro-2H-imidazol-2-ylidene)gold(III) chloride.

What is the chemical formula of the compound?

The chemical formula of the compound is C29H41AuClN2-.

In what form does the compound exist?

The compound exists in powder form.

How sensitive is the compound to air?

The compound is air sensitive.

What color is the compound?

The compound is white in color.

What functional groups are present in the compound?

The compound contains chloro, phenyl, methyl, imidazol-ylidene, and gold functional groups.