Bis(triphenylphosphine)cobalt dichloride

Catalog Number	ACM14126400-2
CAS	14126-40-0
Structure
Synonyms	Dichlorobis(triphenylphosphine)cobalt(II)
Molecular Weight	654.41
Molecular Formula	C36H30Cl2CoP2
Canonical SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Co]Cl
InChI	InChI=1S/2C18H15P.2ClH.Co/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;2*1H;/q;+2/p-2
InChI Key	OPRPFIIIFJLFCE-UHFFFAOYSA-L
Melting Point	236 °C
Purity	98%
Appearance	Powder
Complexity	204
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	653.053174
Heavy Atom Count	41
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	653.053174
Rotatable Bond Count	6
Topological Polar Surface Area	0 Ų

Q&A

What is the chemical formula for Bis(triphenylphosphine)cobalt dichloride?

The chemical formula is C36H30Cl2CoP2.

What is the melting point of Bis(triphenylphosphine)cobalt dichloride?

The melting point is 236 °C.

How do you store Bis(triphenylphosphine)cobalt dichloride?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of Bis(triphenylphosphine)cobalt dichloride?

It is blue in color.

What are the hazard codes associated with Bis(triphenylphosphine)cobalt dichloride?

The hazard code is Xn.

What is the safety statement related to Bis(triphenylphosphine)cobalt dichloride?

The safety statement is 36.

What is the risk statement for Bis(triphenylphosphine)cobalt dichloride?

The risk statement is 20/21/22.

How is Bis(triphenylphosphine)cobalt dichloride used as a catalyst?

It is used as a catalyst in three-component coupling reactions, Epoxidation reactions, Hydrovinylation of Styrene, cross-coupling reactions, dimerization reactions, and oxidation reactions.

What reactions can Bis(triphenylphosphine)cobalt dichloride catalyze?

It can catalyze hydrostannations, alkyne-dihalomethaneamine couplings, cobalt-catalyzed transformation of alkynyl C-H bond, and aldehyde-alkyne-amine coupling.

What are some of the product categories that Bis(triphenylphosphine)cobalt dichloride falls under?

It falls under the categories of Catalysis, Inorganic Chemistry, Chemical Synthesis, and Cobalt.