1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene

Catalog Number	ACM141556425-3
CAS	141556-42-5
Structure
Synonyms	1,3-Bis(2,4,6-trimethylphenyl)imidazol-2-ylidene
IUPAC Name	1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide
Molecular Weight	304.43
Molecular Formula	C21H24N2
InChI	JCYWCSGERIELPG-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H24N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h7-12H,1-6H3
Boiling Point	442.706 °C at 760 mmHg
Melting Point	140 °C
Purity	98%
Appearance	Beige powder
Isomeric SMILES	CC1=CC(=C(C(=C1)C)N2C=C[N+](=[C-]2)C3=C(C=C(C=C3C)C)C)C

Q&A

What is the molecular weight of 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene?

The molecular weight of 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene is 304.42866.

What is the product category that 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene belongs to?

It belongs to the N-heterocyclic carbene product category.

How is 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene commonly referred to?

It is commonly referred to as IMes.

What is the storage temperature recommended for 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene?

The recommended storage temperature is -20°C.

What color is 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene typically?

It is typically white to off-white in color.

How is 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene used in reactions?

It is used as a nucleophilic carbene that serves as a bulky, electron-rich "phosphine mimic" for metal-catalyzed reactions.

What reactions can 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene be used in?

It can be used in the palladium-catalyzed Suzuki cross-coupling of aryl chlorides and as a catalyst for ring-closing metathesis.

What is one of the uses of 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene?

It is used as a ligand in Pd-catalyzed Suzuki-Miyaura cross-coupling reactions.

How does 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene serve as a catalyst in hydrogenation reactions?

It serves as a catalyst for the selective hydrogenation of substituted aryl and heteroaryl boronate esters to cis-substituted borylated cycloalkanes.

What is the chemical formula for 1,3-Bis(2,4,6-trimethylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene?

The chemical formula is C21H24N2.