| Catalog Number |
ACM53199318-2 |
| CAS |
53199-31-8 |
| Structure |
 |
| Description |
Our company can provide customers with rich supported precious metal catalyst products such as palladium series, platinum series, rhodium series and ruthenium series. Our catalysts not only have high catalytic efficiency, strong selectivity, and recyclability, but also can be used in organic reactions such as hydrogenation, dehydrogenation, amination, and cyclization. In addition, some products can also be used as raw materials for various precious metal compounds. The company has formed a series of proprietary and characteristic process technologies, and is currently undergoing process improvement and upgrading. In short, our catalytic products can be widely used in medicine, new chemical materials, pesticides, dyes and pigments, environmental protection, new energy, electronics, basic chemicals and other fields. |
| Synonyms |
Tritert-butylphosphane |
| Molecular Weight |
511.05 g/mol |
| Molecular Formula |
C24H54P2Pd |
| Canonical SMILES |
[Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| InChI |
1S/2C12H27P.Pd/c2*1-10(2,3)13(11(4,5)6)12(7,8)9;/h2*1-9H3; |
| InChI Key |
MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Melting Point |
258-272 °C |
| Purity |
99% |
| Appearance |
Solid |
| Application |
·Catalyst for coupling reaction;
·Catalysts for the Buchwald-Hartwig amination of halogenated aromatic hydrocarbons;
·Catalyst for the carbonylation of halogenated aromatic hydrocarbons with carbamoylsilanes. |
| Storage |
-20 °C |
| Complexity |
128 |
| Covalently-Bonded Unit Count |
3 |
| Defined Atom Stereocenter Count |
0 |
| EC Number |
640-284-9 |
| Exact Mass |
510.27356 |
| Heavy Atom Count |
27 |
| Hydrogen Bond Acceptor Count |
0 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD03094580 |
| Monoisotopic Mass |
510.27356 |
| Rotatable Bond Count |
6 |
| Topological Polar Surface Area |
0 Ų |
