ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Bis(perfluorophenyl)phosphine oxide

Catalog Number ACM1113039647
CAS 1113039-64-7
Synonyms Oxo-bis(2,3,4,5,6-pentafluorophenyl)phosphanium
IUPAC Name oxo-bis(2,3,4,5,6-pentafluorophenyl)phosphanium
Molecular Weight 382.09
Molecular Formula C12HF10OP
InChI AIDVSRHBJMMHDS-UHFFFAOYSA-N
InChI Key InChI=1S/C12F10OP/c13-1-3(15)7(19)11(8(20)4(1)16)24(23)12-9(21)5(17)2(14)6(18)10(12)22/q+1
Purity 98%
Isomeric SMILES C1(=C(C(=C(C(=C1F)F)[P+](=O)C2=C(C(=C(C(=C2F)F)F)F)F)F)F)F
Q&A

What is the IUPAC name of the compound bis(perfluorophenyl)phosphine oxide?

The IUPAC name of the compound is oxo-bis(2,3,4,5,6-pentafluorophenyl)phosphanium.

What is the exact mass of bis(perfluorophenyl)phosphine oxide?

The exact mass of the compound is 380.95270824.

How many hydrogen bond acceptors does bis(perfluorophenyl)phosphine oxide have?

Bis(perfluorophenyl)phosphine oxide has 11 hydrogen bond acceptors.

What is the molecular formula of bis(perfluorophenyl)phosphine oxide?

The molecular formula is C12F10OP+.

How many heavy atoms does the compound bis(perfluorophenyl)phosphine oxide have?

The compound has 24 heavy atoms.

Is there any defined atom stereocenter count in bis(perfluorophenyl)phosphine oxide?

No, there is no defined atom stereocenter count.

What is the Canonical SMILES representation of bis(perfluorophenyl)phosphine oxide?

The Canonical SMILES representation is C1(=C(C(=C(C(=C1F)F)[P+](=O)C2=C(C(=C(C(=C2F)F)F)F)F)F)F)F.

What is the main function of bis(perfluorophenyl)phosphine oxide?

The exact function of the compound is not specified.

What is the CAS Registry Number of bis(perfluorophenyl)phosphine oxide?

The CAS Registry Number is 1113039-64-7.

How many rotatable bonds does bis(perfluorophenyl)phosphine oxide have?

The compound has 2 rotatable bonds.

Please kindly note that our products and services are for research use only.