Bis(pentafluorophenyl)zinc

Catalog Number	ACM1799902-2
CAS	1799-90-2
Structure
Synonyms	Bis(2,3,4,5,6-pentafluorophenyl)zinc
IUPAC Name	Zinc;1,2,3,4,5-pentafluorobenzene-6-ide
Molecular Weight	399.5
Molecular Formula	C12F10Zn
Canonical SMILES	[C-]1=C(C(=C(C(=C1F)F)F)F)F.[C-]1=C(C(=C(C(=C1F)F)F)F)F.[Zn+2]
InChI	InChI=1S/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2
InChI Key	TURVSLXVJYZFII-UHFFFAOYSA-N
Melting Point	100-105 °C
Purity	95%+
Appearance	Powder
Storage	room temperature
Complexity	578
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	397.913173
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	0
Monoisotopic Mass	397.913173
Rotatable Bond Count	0
Topological Polar Surface Area	0 Ų

Q&A

What is the molecular formula of Bis(pentafluorophenyl)zinc?

The molecular formula is C12F10Zn.

When was Bis(pentafluorophenyl)zinc created?

It was created on September 8, 2005.

What is the computed IUPAC name of Bis(pentafluorophenyl)zinc?

The computed IUPAC name is zinc;1,2,3,4,5-pentafluorobenzene-6-ide.

What is the InChI of Bis(pentafluorophenyl)zinc?

The InChI is InChI=1S/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2.

What is the InChIKey of Bis(pentafluorophenyl)zinc?

The InChIKey is TURVSLXVJYZFII-UHFFFAOYSA-N.

What is the canonical SMILES of Bis(pentafluorophenyl)zinc?

The canonical SMILES is [C-]1=C(C(=C(C(=C1F)F)F)F)F.[C-]1=C(C(=C(C(=C1F)F)F)F)F.[Zn+2].

What is the molecular weight of Bis(pentafluorophenyl)zinc?

The molecular weight is 399.5 g/mol.

How many hydrogen bond donor counts does Bis(pentafluorophenyl)zinc have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Bis(pentafluorophenyl)zinc have?

It has 12 hydrogen bond acceptor counts.

How many rotatable bond counts does Bis(pentafluorophenyl)zinc have?

It has 0 rotatable bond counts.