What is the CAS number for Bis(4-fluorophenyl)phosphine?
The CAS number for Bis(4-fluorophenyl)phosphine is 94940-35-9.
How many heavy atoms are present in the molecular structure of Bis(4-fluorophenyl)phosphine?
There are 16 heavy atoms present in the molecular structure of Bis(4-fluorophenyl)phosphine.
What is the molecular weight of Bis(4-fluorophenyl)phosphine?
The molecular weight of Bis(4-fluorophenyl)phosphine is 237.16g/mol.
What is the IUPAC name of Bis(4-fluorophenyl)phosphine?
The IUPAC name of Bis(4-fluorophenyl)phosphine is bis(4-fluorophenyl)-oxophosphanium.
How many hydrogen bond acceptors are present in the molecular structure of Bis(4-fluorophenyl)phosphine?
There are 3 hydrogen bond acceptors present in the molecular structure of Bis(4-fluorophenyl)phosphine.
What is the exact mass of Bis(4-fluorophenyl)phosphine?
The exact mass of Bis(4-fluorophenyl)phosphine is 237.02808320.
What is the Canonical SMILES representation of Bis(4-fluorophenyl)phosphine?
The Canonical SMILES representation of Bis(4-fluorophenyl)phosphine is C1=CC(=CC=C1F)[P+](=O)C2=CC=C(C=C2)F.
What is the InChIKey for Bis(4-fluorophenyl)phosphine?
The InChIKey for Bis(4-fluorophenyl)phosphine is MIYITCTXDGORJJ-UHFFFAOYSA-N.
How many rotatable bonds are present in the molecular structure of Bis(4-fluorophenyl)phosphine?
There are 2 rotatable bonds present in the molecular structure of Bis(4-fluorophenyl)phosphine.
What are some of the synonyms for Bis(4-fluorophenyl)phosphine?
Some synonyms for Bis(4-fluorophenyl)phosphine include bis(4-fluorophenyl)phosphine oxide, bis(4-fluorophenyl)-oxophosphanium, and bis(4-fluorophenyl)-Phosphine oxide.