ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Bis(4-fluorophenyl)phosphine

Catalog Number ACM25186178-1
CAS 25186-17-8
Structure {[CurrentData.Name]}
Synonyms Bis(4-fluorophenyl)phosphane
IUPAC Name bis(4-fluorophenyl)phosphane
Molecular Weight 222.17
Molecular Formula C12H9F2P
InChI DQHUBXVOJVHJAH-UHFFFAOYSA-N
InChI Key InChI=1S/C12H9F2P/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,15H
Boiling Point 110-113 °C(Press: 2 Torr)
Purity 95%
Isomeric SMILES C1=CC(=CC=C1F)PC2=CC=C(C=C2)F
Q&A

What is the CAS number for Bis(4-fluorophenyl)phosphine?

The CAS number for Bis(4-fluorophenyl)phosphine is 94940-35-9.

How many heavy atoms are present in the molecular structure of Bis(4-fluorophenyl)phosphine?

There are 16 heavy atoms present in the molecular structure of Bis(4-fluorophenyl)phosphine.

What is the molecular weight of Bis(4-fluorophenyl)phosphine?

The molecular weight of Bis(4-fluorophenyl)phosphine is 237.16g/mol.

What is the IUPAC name of Bis(4-fluorophenyl)phosphine?

The IUPAC name of Bis(4-fluorophenyl)phosphine is bis(4-fluorophenyl)-oxophosphanium.

How many hydrogen bond acceptors are present in the molecular structure of Bis(4-fluorophenyl)phosphine?

There are 3 hydrogen bond acceptors present in the molecular structure of Bis(4-fluorophenyl)phosphine.

What is the exact mass of Bis(4-fluorophenyl)phosphine?

The exact mass of Bis(4-fluorophenyl)phosphine is 237.02808320.

What is the Canonical SMILES representation of Bis(4-fluorophenyl)phosphine?

The Canonical SMILES representation of Bis(4-fluorophenyl)phosphine is C1=CC(=CC=C1F)[P+](=O)C2=CC=C(C=C2)F.

What is the InChIKey for Bis(4-fluorophenyl)phosphine?

The InChIKey for Bis(4-fluorophenyl)phosphine is MIYITCTXDGORJJ-UHFFFAOYSA-N.

How many rotatable bonds are present in the molecular structure of Bis(4-fluorophenyl)phosphine?

There are 2 rotatable bonds present in the molecular structure of Bis(4-fluorophenyl)phosphine.

What are some of the synonyms for Bis(4-fluorophenyl)phosphine?

Some synonyms for Bis(4-fluorophenyl)phosphine include bis(4-fluorophenyl)phosphine oxide, bis(4-fluorophenyl)-oxophosphanium, and bis(4-fluorophenyl)-Phosphine oxide.

Please kindly note that our products and services are for research use only.